ft: switch to click movement

.gitignore

@@ -49,4 +49,3 @@ export_presets.cfg
 data_*/
 mono_crash.*.json
 
-addons/

evolve-die-repeat/addons/modular-settings-menu/LICENSE

@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024-present Mark Velez
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.

evolve-die-repeat/addons/modular-settings-menu/plugin.cfg

@@ -0,0 +1,7 @@
+[plugin]
+
+name="Modular Settings Menu"
+description="A fully modular settings menu that can be customized with ease."
+author="Mark Velez"
+version="1.0.0"
+script="plugin.gd"

evolve-die-repeat/addons/modular-settings-menu/plugin.gd

@@ -0,0 +1,13 @@
+@tool
+extends EditorPlugin
+
+var pluginPath: String = get_script().resource_path.get_base_dir()
+const settingsDataManagerPath: String = "/singletons/settings_data_manager.gd"
+
+
+func _enter_tree():
+	add_autoload_singleton("SettingsDataManager", pluginPath + settingsDataManagerPath)
+
+
+func _exit_tree():
+	remove_autoload_singleton("SettingsDataManager")

evolve-die-repeat/addons/modular-settings-menu/plugin.gd.uid

@@ -0,0 +1 @@
+uid://7kssh3jmekkk

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/audio-elements/master_volume.tscn

@@ -0,0 +1,53 @@
+[gd_scene load_steps=4 format=3 uid="uid://pir75xaw2g08"]
+
+[ext_resource type="Script" path="res://addons/modular-settings-menu/scripts/settings-elements-scripts/audio_setting.gd" id="1_n7p26"]
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hlot4"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_4i2xw"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hlot4")
+
+[node name="MasterVolume" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = ExtResource("1_n7p26")
+AUDIO_BUS = "Master"
+STEP_VALUE = 0.01
+DISPLAY_PERCENT_VALUE = true
+VALUE_SUFFIX = "%"
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "MasterVolume"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Master"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_4i2xw")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/audio-elements/music_volume.tscn

@@ -0,0 +1,53 @@
+[gd_scene load_steps=4 format=3 uid="uid://y6kuxwyem48c"]
+
+[ext_resource type="Script" path="res://addons/modular-settings-menu/scripts/settings-elements-scripts/audio_setting.gd" id="1_05os8"]
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hlot4"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_4i2xw"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hlot4")
+
+[node name="MusicVolume" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = ExtResource("1_05os8")
+AUDIO_BUS = "Music"
+STEP_VALUE = 0.01
+DISPLAY_PERCENT_VALUE = true
+VALUE_SUFFIX = "%"
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "MusicVolume"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Music"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_4i2xw")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/audio-elements/sfx_volume.tscn

@@ -0,0 +1,53 @@
+[gd_scene load_steps=4 format=3 uid="uid://jl3iirunm0hq"]
+
+[ext_resource type="Script" path="res://addons/modular-settings-menu/scripts/settings-elements-scripts/audio_setting.gd" id="1_b0uh7"]
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hlot4"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_4i2xw"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hlot4")
+
+[node name="SFXVolume" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = ExtResource("1_b0uh7")
+AUDIO_BUS = "SFX"
+STEP_VALUE = 0.01
+DISPLAY_PERCENT_VALUE = true
+VALUE_SUFFIX = "%"
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "SFXVolume"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "SFX"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_4i2xw")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/controls-elements/input-settings-panel/input-settings-panel-elements/input_button.tscn

@@ -0,0 +1,38 @@
+[gd_scene load_steps=2 format=3 uid="uid://bbtri7oyxvehi"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_jjel1"]
+
+[node name="InputButton" type="PanelContainer"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+
+[node name="MarginContainer" type="MarginContainer" parent="."]
+layout_mode = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="HBoxContainer" type="HBoxContainer" parent="MarginContainer"]
+layout_mode = 2
+
+[node name="ActionLabel" type="Label" parent="MarginContainer/HBoxContainer"]
+layout_mode = 2
+size_flags_horizontal = 2
+size_flags_vertical = 1
+mouse_filter = 1
+text = "action name"
+horizontal_alignment = 1
+vertical_alignment = 1
+
+[node name="ActionInput" type="Button" parent="MarginContainer/HBoxContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+mouse_filter = 1
+theme_override_styles/focus = SubResource("StyleBoxEmpty_jjel1")
+text = "input key"

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/controls-elements/input-settings-panel/input_settings_panel.tscn

@@ -0,0 +1,305 @@
+[gd_scene format=3 uid="uid://cqqhgk8ufkmqa"]
+
+[ext_resource type="PackedScene" uid="uid://bbtri7oyxvehi" path="res://addons/modular-settings-menu/scenes/settings-elements/controls-elements/input-settings-panel/input-settings-panel-elements/input_button.tscn" id="1_1y7ch"]
+
+[sub_resource type="GDScript" id="GDScript_0eq0v"]
+resource_name = "input_settings_panel"
+script/source = "extends Control
+
+# Button scene for actions
+@export var InputButtonScene: PackedScene
+
+# Panel node references
+@onready var ActionListRef: VBoxContainer = %ActionList
+@onready var ResetButtonRef: Button = %ResetButton
+@onready var BackButtonRef: Button = $VBoxContainer/HBoxContainer/BackButton
+@onready var ApplyButtonRef: Button = $VBoxContainer/HBoxContainer/ApplyButton
+
+# List of events for each action
+var actionEvents_: Dictionary
+# Cache for changed actions
+var panelCache_: Dictionary
+# Reference list to the button for each action
+var actionReferenceList_: Dictionary
+
+# Reference to the element this panel belongs to
+var PanelOwnerRef: ButtonElement
+
+# For remapping
+var isRemapping: bool = false
+var actionToRemap: String
+var ActionInputButtonRef: Button
+
+
+func _ready():
+	# Connect necessary signals
+	ResetButtonRef.connect(\"pressed\", on_reset_button_pressed)
+	BackButtonRef.connect(\"pressed\", on_back_button_pressed)
+	ApplyButtonRef.connect(\"pressed\", on_apply_button_pressed)
+
+
+# Called to populate the action list with actions
+func create_action_list(reset: bool = false) -> void:
+	# All the remappable actions
+	var INPUT_ACTIONS_: Dictionary = PanelOwnerRef.ACTION_LIST_.duplicate()
+	INPUT_ACTIONS_.make_read_only()
+	
+	# Get the events for the actions
+	actionEvents_ = get_events(INPUT_ACTIONS_, reset)
+	
+	# Check if the action list is already populated
+	if ActionListRef.get_child_count() > 0:
+		# Remove all the existing actions from the action list
+		for child in ActionListRef.get_children():
+			child.queue_free()
+	
+	# Create the actions for the action list
+	for action in INPUT_ACTIONS_:
+		# Instantiate the button scene
+		var ButtonRef: PanelContainer = InputButtonScene.instantiate()
+		# Get references to the elements of the button scene
+		var ActionLabelRef: Label = ButtonRef.find_child(\"ActionLabel\")
+		var ActionInputRef: Button = ButtonRef.find_child(\"ActionInput\")
+		# Get the event for the action
+		var event = actionEvents_[action]
+		
+		# Add a reference of the instantiated button to the reference list
+		actionReferenceList_[action] = ButtonRef
+		# Change the label text of the button to the action it corresponds to
+		ActionLabelRef.set_text(INPUT_ACTIONS_[action])
+		ActionInputRef.set_text(event.as_text())
+		
+		ActionListRef.add_child(ButtonRef)
+		ActionInputRef.connect(
+			\"pressed\",
+			on_input_button_pressed.bind(action, ActionInputRef)
+		)
+
+
+func on_input_button_pressed(action: String, ActionInputRef: Button) -> void:
+	# Check if a button is not being remapped currently
+	if not isRemapping:
+		isRemapping = true
+		actionToRemap = action
+		ActionInputButtonRef = ActionInputRef
+		ActionInputRef.set_text(\"Press key to bind...\")
+
+
+func _input(event: InputEvent):
+	# Check if an action is being remapped currently
+	if isRemapping:
+		# Check if the desired input is either a keyboard or mouse input
+		if (
+			event is InputEventKey
+			or event is InputEventMouseButton
+			and event.pressed
+		):
+			# Check if the event is a mouse event and if it was a double click
+			if event is InputEventMouseButton and event.double_click:
+				# Disable the double click flag
+				event.double_click = false
+			
+			# Set the input button's text to the inputted event
+			ActionInputButtonRef.set_text(event.as_text())
+			
+			# Check if the inputted event is different compared to the saved one for the action
+			if not check_matching_event(event):
+				var duplicateEvent: String = check_duplicate_event(event)
+				actionEvents_[actionToRemap] = event
+				panelCache_[actionToRemap] = event
+				ApplyButtonRef.set_disabled(false)
+				
+				if duplicateEvent:
+					var ActionInputRef: Button =\\
+						actionReferenceList_[duplicateEvent].find_child(
+							\"ActionInput\"
+						)
+					actionEvents_[duplicateEvent] = InputEventKey.new()
+					panelCache_[duplicateEvent] = actionEvents_[duplicateEvent]
+					ActionInputRef.set_text(
+						actionEvents_[duplicateEvent].as_text()
+					)
+			
+			isRemapping = false
+			actionToRemap = \"\"
+			ActionInputButtonRef = null
+			
+			accept_event()
+
+
+# Checks if the inputted event matches the one saved for the action
+func check_matching_event(event: InputEvent) -> bool:
+	var eventType: String = event.get_class()
+	var eventButton: int = get_event_button(event)
+	var currentEvent = actionEvents_[actionToRemap]
+	
+	# Check if the event matches the action to be remapped
+	if (
+		currentEvent.is_class(eventType)
+		and get_event_button(currentEvent) == eventButton
+	):
+		return true
+	
+	return false
+
+
+# Checks if any other action has the inputted event as it's event
+func check_duplicate_event(event: InputEvent) -> String:
+	var eventType: String = event.get_class()
+	var eventButton: int = get_event_button(event)
+	
+	# Check for duplicates in other actions
+	for action in actionEvents_:
+		# Check if the action is not the one being remapped
+		if action != actionToRemap:
+			var storedEvent = actionEvents_[action]
+			
+			# Check if the input type and event matches the inputted event
+			if (
+				storedEvent.is_class(eventType)
+				and get_event_button(storedEvent) == eventButton
+			):
+				return action
+	
+	return \"\"
+
+
+# Called to get the physical index for the inputted event depending on the input event's type
+func get_event_button(event: InputEvent) -> int:
+	# Check for the input event's type
+	match event.get_class():
+		\"InputEventKey\":
+			return event.get_keycode()
+		\"InputEventMouseButton\":
+			return event.get_button_index()
+	
+	return -1
+
+
+# Called to update the action's events to the cached events
+func update_action_events(actionList_: Dictionary) -> void:
+	# Itterate through all the recieved actions
+	for action in actionList_:
+		# Remove all events for the action
+		InputMap.action_erase_events(action)
+		
+		# Check if the action has an event assigned to it
+		if actionList_[action]:
+			# Add the new event to the action
+			InputMap.action_add_event(action, actionList_[action])
+
+
+# Called to get all the events for the remappable actions
+func get_events(actions_: Dictionary, reset: bool = false) -> Dictionary:
+	var events_: Dictionary = {}
+	
+	if PanelOwnerRef.noSaveFile or PanelOwnerRef.invalidSaveFile or reset:
+		InputMap.load_from_project_settings()
+		for action in actions_:
+			# Retrieve the first event for the action
+			events_[action] = InputMap.action_get_events(action)[0]
+		panelCache_ = events_.duplicate(true)
+	else:
+		# Retrieve the events from the loaded data
+		events_ = PanelOwnerRef.inputSettingsData_.duplicate()
+	
+	return events_
+
+
+func on_reset_button_pressed():
+	panelCache_.clear()
+	create_action_list(true)
+	ApplyButtonRef.set_disabled(false)
+
+
+func on_back_button_pressed():
+	# Check if there have been any changes made
+	if ApplyButtonRef.is_disabled():
+		# Clear the cache and return normally
+		panelCache_.clear()
+		hide()
+		owner.SettingsPanelRef.show()
+	else:
+		# Display the discard changes popup
+		owner.display_discard_changes(self)
+
+
+func on_apply_button_pressed():
+	# Update the input map
+	update_action_events(panelCache_)
+	panelCache_.clear()
+	# Send the new data to the parent element
+	PanelOwnerRef.panel_settings_changed(actionEvents_)
+	ApplyButtonRef.set_disabled(true)
+"
+
+[node name="InputSettingsPanel" type="Control"]
+layout_mode = 3
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_0eq0v")
+InputButtonScene = ExtResource("1_1y7ch")
+
+[node name="VBoxContainer" type="VBoxContainer" parent="."]
+layout_mode = 1
+anchors_preset = 8
+anchor_left = 0.5
+anchor_top = 0.5
+anchor_right = 0.5
+anchor_bottom = 0.5
+offset_left = -194.0
+offset_top = -29.0
+offset_right = 194.0
+offset_bottom = 30.0
+grow_horizontal = 2
+grow_vertical = 2
+
+[node name="PanelContainer" type="PanelContainer" parent="VBoxContainer"]
+custom_minimum_size = Vector2(0, 280)
+layout_mode = 2
+
+[node name="MarginContainer" type="MarginContainer" parent="VBoxContainer/PanelContainer"]
+layout_mode = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="VBoxContainer" type="VBoxContainer" parent="VBoxContainer/PanelContainer/MarginContainer"]
+layout_mode = 2
+
+[node name="ScrollContainer" type="ScrollContainer" parent="VBoxContainer/PanelContainer/MarginContainer/VBoxContainer"]
+layout_mode = 2
+size_flags_vertical = 3
+
+[node name="ActionList" type="VBoxContainer" parent="VBoxContainer/PanelContainer/MarginContainer/VBoxContainer/ScrollContainer"]
+unique_name_in_owner = true
+layout_mode = 2
+size_flags_horizontal = 3
+
+[node name="ResetButton" type="Button" parent="VBoxContainer/PanelContainer/MarginContainer/VBoxContainer"]
+unique_name_in_owner = true
+layout_mode = 2
+focus_mode = 0
+text = "Reset to default"
+
+[node name="HBoxContainer" type="HBoxContainer" parent="VBoxContainer"]
+layout_mode = 2
+
+[node name="ApplyButton" type="Button" parent="VBoxContainer/HBoxContainer"]
+layout_direction = 1
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+disabled = true
+text = "Apply"
+
+[node name="BackButton" type="Button" parent="VBoxContainer/HBoxContainer"]
+layout_direction = 1
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+text = "Back"

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/controls-elements/input_settings.tscn

@@ -0,0 +1,165 @@
+[gd_scene format=3 uid="uid://i0w5gftb0j16"]
+
+[ext_resource type="PackedScene" uid="uid://cqqhgk8ufkmqa" path="res://addons/modular-settings-menu/scenes/settings-elements/controls-elements/input-settings-panel/input_settings_panel.tscn" id="1_6pc66"]
+
+[sub_resource type="GDScript" id="GDScript_te2ja"]
+resource_name = "input_settings"
+script/source = "extends ButtonElement
+
+##List of actions to make remappable and how the name they should display.
+@export var ACTION_LIST_: Dictionary = {
+	\"ui_up\": \"Up\",
+	\"ui_down\": \"Down\",
+	\"ui_left\": \"Left\",
+	\"ui_right\": \"Right\",
+}
+
+# Path to the settings save file
+var DATA_FOLDER: String = SettingsDataManager.DATA_FOLDER
+const FILE_NAME: String = \"keybinds\"
+const FILE_EXTENSION: String = \".json\"
+var PATH: String = DATA_FOLDER + \"/\" + FILE_NAME + FILE_EXTENSION
+
+# Currently stored input data
+var inputSettingsData_: Dictionary
+
+# Flag for checking if a save file exists for input settings
+var noSaveFile: bool
+# Flag for checking if an invalid value was found in the save file
+var invalidSaveFile: bool = false
+
+
+func _ready():
+	super._ready()
+	ACTION_LIST_.make_read_only()
+	SettingsDataManager.connect(\"settings_retrieved\", load_settings)
+	# Verify the directory
+	DirAccess.make_dir_absolute(DATA_FOLDER)
+	# Check if a save file exists
+	if not FileAccess.file_exists(PATH):
+		noSaveFile = true
+
+
+# Loads the saved/default values of the element
+func load_settings() -> void:
+	# Get the current value for the element
+	if noSaveFile:
+		# Get the events for the remappable actions from the project settings
+		inputSettingsData_ = ElementPanelRef.get_events(ACTION_LIST_)
+		save_input_settings()
+	else:
+		get_input_settings()
+	
+	# Check if save file is valid
+	if invalidSaveFile:
+		# Get the events for the remappable actions from the project settings
+		inputSettingsData_ = ElementPanelRef.get_events(ACTION_LIST_)
+		save_input_settings()
+	else:
+		call_deferred(\"apply_settings\")
+
+
+func pressed() -> void:
+	# Check if a save file exists
+	if not FileAccess.file_exists(PATH):
+		noSaveFile = true
+	
+	ElementPanelRef.create_action_list()
+	# Switch panels
+	ParentRef.SettingsMenuRef.SettingsPanelRef.hide()
+	ElementPanelRef.show()
+
+
+# Called to apply the settings in the settings cache
+func apply_settings() -> void:
+	# Assign the events for the remappable actions
+	ElementPanelRef.update_action_events(inputSettingsData_)
+
+
+# Called to update the input settings data
+func panel_settings_changed(newValue_: Dictionary) -> void:
+	inputSettingsData_ = newValue_.duplicate()
+	save_input_settings()
+
+
+# Called to save the input settings
+func save_input_settings() -> void:
+	var file := FileAccess.open(PATH, FileAccess.WRITE)
+	var data_: Dictionary = {}
+	
+	# Itterate through the input settings
+	for input in inputSettingsData_:
+		var inputEvent = inputSettingsData_[input]
+		# Serialize the InputEvent of the action
+		match inputEvent.get_class():
+			\"InputEventKey\":
+				data_[input] = {
+					\"type\": \"keyboard\",
+					\"key\": inputEvent.get_keycode()
+				}
+			\"InputEventMouseButton\":
+				data_[input] = {
+					\"type\": \"mouse\",
+					\"button\": inputEvent.get_button_index()
+				}
+	
+	# Save the string to a json file
+	file.store_string(JSON.stringify(data_, \"\\t\", false))
+	file.close()
+	noSaveFile = false
+
+
+# Called to retrieve the input settings data from the save file
+func get_input_settings() -> void:
+	var file := FileAccess.open(PATH, FileAccess.READ)
+	# Parse the json string to a dictionary
+	var data_ = JSON.parse_string(file.get_as_text())
+	file.close()
+	
+	# Check if there were any errors or if the save file is empty
+	if data_ == null or data_.is_empty():
+		push_error(\"Failed to parse input settings\")
+		invalidSaveFile = true
+		return
+	
+	verify_settings_data(data_)
+
+
+# Used for verifying the integrity of the save file
+func verify_settings_data(data_: Dictionary) -> void:
+	# Itterate through all the retrieved data
+	for input in data_:
+		# Check if the action exists
+		if not ACTION_LIST_.has(input):
+			push_warning(\"Invalid input settings entry: \", input)
+			invalidSaveFile = true
+			continue
+		
+		# Reconstruct the InputEvent for the action
+		match data_[input][\"type\"]:
+			\"keyboard\":
+				var key := InputEventKey.new()
+				key.set_keycode(data_[input][\"key\"])
+				inputSettingsData_[input] = key
+			\"mouse\":
+				var button := InputEventMouseButton.new()
+				button.set_button_index(data_[input][\"button\"])
+				inputSettingsData_[input] = button
+	
+	# Itterate through all the expected actions
+	for action in ACTION_LIST_:
+		if not data_.has(action):
+			data_[action] = InputMap.action_get_events(action)[0]
+			invalidSaveFile = true
+			push_warning(\"Input action is missing: \", action)
+"
+
+[node name="InputSettings" type="Button"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+text = "Input Settings"
+script = SubResource("GDScript_te2ja")
+ElementPanelScene = ExtResource("1_6pc66")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/controls-elements/invert_y.tscn

@@ -0,0 +1,37 @@
+[gd_scene load_steps=3 format=3 uid="uid://c2tgt7fu0n5wp"]
+
+[sub_resource type="GDScript" id="GDScript_te2ja"]
+resource_name = "invert_y"
+script/source = "extends ToggleElement
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="InvertY" type="HBoxContainer" node_paths=PackedStringArray("ToggleRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_te2ja")
+ToggleRef = NodePath("Toggle")
+IDENTIFIER = "InvertY"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Invert Y-Axis"
+vertical_alignment = 1
+
+[node name="Toggle" type="CheckButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/controls-elements/sensitivity.tscn

@@ -0,0 +1,60 @@
+[gd_scene load_steps=4 format=3 uid="uid://cy8n6yalxprb7"]
+
+[sub_resource type="GDScript" id="GDScript_s1j2c"]
+resource_name = "sensitivity"
+script/source = "extends SliderElement
+
+
+# Element specific script for applying its value to the game
+func _apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+"
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hlot4"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_4i2xw"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hlot4")
+
+[node name="Sensitivity" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_s1j2c")
+MAX_VALUE = 5.0
+STEP_VALUE = 0.01
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "Sensitivity"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Mouse Sensitivity"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_4i2xw")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/discard_changes_popup.tscn

@@ -0,0 +1,94 @@
+[gd_scene load_steps=3 format=3 uid="uid://dvkksl3mrnoto"]
+
+[sub_resource type="GDScript" id="GDScript_pvp7f"]
+resource_name = "discard_changes_popup"
+script/source = "extends PanelContainer
+
+@onready var YesButtonRef: Button = %YesButton
+@onready var NoButtonRef: Button = %NoButton
+
+var CallerRef: Control
+
+
+func _ready():
+	# Connect necessary signals
+	YesButtonRef.connect(\"pressed\", yes_button_pressed)
+	NoButtonRef.connect(\"pressed\", no_button_pressed)
+	connect(\"hidden\", on_hidden)
+
+
+func yes_button_pressed() -> void:
+	# Check if the panel this belongs to has the \"discard changes\" function
+	if CallerRef.has_method(\"discard_changes\"):
+		CallerRef.discard_changes()
+	
+	# Disable the panel's apply button
+	CallerRef.ApplyButtonRef.set_disabled(true)
+	CallerRef.on_back_button_pressed()
+	
+	# Reset the changed elements count
+	SettingsDataManager.changedElementsCount = 0
+	
+	hide()
+
+
+func no_button_pressed() -> void:
+	hide()
+
+
+func on_hidden() -> void:
+	CallerRef = null
+"
+
+[sub_resource type="StyleBoxFlat" id="StyleBoxFlat_8kuxy"]
+bg_color = Color(0.162066, 0.162066, 0.162065, 1)
+corner_radius_top_left = 4
+corner_radius_top_right = 4
+corner_radius_bottom_right = 4
+corner_radius_bottom_left = 4
+
+[node name="DiscardChangesPopup" type="PanelContainer"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_pvp7f")
+
+[node name="PopupWindow" type="PanelContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 4
+size_flags_vertical = 4
+theme_override_styles/panel = SubResource("StyleBoxFlat_8kuxy")
+
+[node name="MarginContainer" type="MarginContainer" parent="PopupWindow"]
+layout_mode = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 4
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="VBoxContainer" type="VBoxContainer" parent="PopupWindow/MarginContainer"]
+layout_mode = 2
+theme_override_constants/separation = 8
+
+[node name="Text" type="Label" parent="PopupWindow/MarginContainer/VBoxContainer"]
+layout_mode = 2
+text = "Would you like to discard
+all changes done?"
+
+[node name="HBoxContainer" type="HBoxContainer" parent="PopupWindow/MarginContainer/VBoxContainer"]
+layout_mode = 2
+theme_override_constants/separation = 8
+
+[node name="YesButton" type="Button" parent="PopupWindow/MarginContainer/VBoxContainer/HBoxContainer"]
+unique_name_in_owner = true
+layout_mode = 2
+size_flags_horizontal = 3
+text = "Yes"
+
+[node name="NoButton" type="Button" parent="PopupWindow/MarginContainer/VBoxContainer/HBoxContainer"]
+unique_name_in_owner = true
+layout_mode = 2
+size_flags_horizontal = 3
+text = "No"

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/gameplay-elements/fov.tscn

@@ -0,0 +1,63 @@
+[gd_scene load_steps=4 format=3 uid="uid://elu1vc0ox472"]
+
+[sub_resource type="GDScript" id="GDScript_1rk38"]
+resource_name = "fov"
+script/source = "extends SliderElement
+
+
+# Element specific script for applying its value to the game
+func _apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+"
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hlot4"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_4i2xw"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hlot4")
+
+[node name="FOV" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_1rk38")
+MIN_VALUE = 30.0
+MAX_VALUE = 120.0
+STEP_VALUE = 1.0
+DEFAULT_VALUE = 75.0
+VALUE_SUFFIX = "°"
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "FOV"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Field of View"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_4i2xw")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/anti_aliasing.tscn

@@ -0,0 +1,83 @@
+[gd_scene load_steps=3 format=3 uid="uid://csg6c3uuct1ls"]
+
+[sub_resource type="GDScript" id="GDScript_5w56l"]
+resource_name = "anti_aliasing"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = [
+		\"Disabled\",
+		\"FXAA\",
+		\"2x MSAA\",
+		\"4x MSAA\",
+		\"8x MSAA\",
+		\"TAA\"
+	]
+
+
+func _apply_settings() -> void:
+	# Enables the selected anti aliasing
+	match currentValue:
+		\"Disabled\":
+			set_anti_aliasing_mode()
+		\"FXAA\":
+			set_anti_aliasing_mode(Viewport.SCREEN_SPACE_AA_FXAA)
+		\"2x MSAA\":
+			set_anti_aliasing_mode(
+				Viewport.SCREEN_SPACE_AA_DISABLED,
+				Viewport.MSAA_2X
+			)
+		\"4x MSAA\":
+			set_anti_aliasing_mode(
+				Viewport.SCREEN_SPACE_AA_DISABLED,
+				Viewport.MSAA_4X
+			)
+		\"8x MSAA\":
+			set_anti_aliasing_mode(
+				Viewport.SCREEN_SPACE_AA_DISABLED,
+				Viewport.MSAA_8X
+			)
+		\"TAA\":
+			set_anti_aliasing_mode(
+				Viewport.SCREEN_SPACE_AA_DISABLED,
+				Viewport.MSAA_DISABLED, true
+			)
+
+
+# Sets the anti aliasing mode according to the values provided
+func set_anti_aliasing_mode(
+	fxaaMode: Viewport.ScreenSpaceAA = Viewport.SCREEN_SPACE_AA_DISABLED,
+	msaaMode: Viewport.MSAA = Viewport.MSAA_DISABLED,
+	taaMode: bool = false
+) -> void:
+	get_viewport().set_screen_space_aa(fxaaMode)
+	get_viewport().set_msaa_3d(msaaMode)
+	get_viewport().set_use_taa(taaMode)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="AntiAliasing" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_5w56l")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "AntiAliasing"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Anti Aliasing"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/depth_of_field.tscn

@@ -0,0 +1,53 @@
+[gd_scene load_steps=3 format=3 uid="uid://3ckate3v614f"]
+
+[sub_resource type="GDScript" id="GDScript_mnbyt"]
+resource_name = "depth_of_field"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Disabled\": null,
+		\"Low\": RenderingServer.DOF_BLUR_QUALITY_LOW,
+		\"Medium\": RenderingServer.DOF_BLUR_QUALITY_MEDIUM,
+		\"High\": RenderingServer.DOF_BLUR_QUALITY_HIGH
+	}
+
+
+func _apply_settings() -> void:
+	if not apply_in_game_setting(currentValue):
+		if currentValue == \"Disabled\":
+			return
+		
+		RenderingServer.camera_attributes_set_dof_blur_quality(
+			OPTION_LIST_[currentValue],
+			true
+		)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="DepthOfField" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_mnbyt")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "DepthOfField"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Depth of Field"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/display_mode.tscn

@@ -0,0 +1,109 @@
+[gd_scene load_steps=3 format=3 uid="uid://byff0jwaicxvr"]
+
+[sub_resource type="GDScript" id="GDScript_duwn0"]
+resource_name = "display_mode"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Fullscreen\": DisplayServer.WINDOW_MODE_EXCLUSIVE_FULLSCREEN,
+		\"Borderless Windowed\": DisplayServer.WINDOW_MODE_WINDOWED,
+		\"Windowed\": DisplayServer.WINDOW_MODE_WINDOWED
+	}
+
+
+func load_settings() -> void:
+	super.load_settings()
+	# Check if the resolution element should be disabled
+	call_deferred(\"check_resolution\")
+
+
+func option_selected(index: int) -> void:
+	super.option_selected(index)
+	# Check if the resolution element should be disabled
+	check_resolution()
+
+
+func _apply_settings() -> void:
+	DisplayServer.window_set_mode(OPTION_LIST_[currentValue])
+	
+	if currentValue == \"Borderless Windowed\":
+		DisplayServer.window_set_flag(
+			DisplayServer.WINDOW_FLAG_BORDERLESS,
+			true
+		)
+		adjust_resolution()
+	else:
+		DisplayServer.window_set_flag(
+			DisplayServer.WINDOW_FLAG_BORDERLESS,
+			false
+		)
+	
+	if currentValue == \"Windowed\":
+		# Set the resolution to 80% if the resolution setting doesnt exist
+		if not ParentRef.ELEMENT_REFERENCE_TABLE_.has(\"Resolution\"):
+			adjust_resolution(0.8)
+			return
+		
+		# Apply the selected resolution manually if it has not been changed
+		if not ParentRef.changedElements_.has(\"Resolution\"):
+			# Resolution change has to be delayed by at least 2 frames.
+			# Otherwise height of the window will be off by a bit.
+			await get_tree().process_frame
+			await get_tree().process_frame
+			# Apply the resolution settings manually
+			ParentRef.ELEMENT_REFERENCE_TABLE_[\"Resolution\"]._apply_settings()
+
+
+# Called to check if the resolution element should be disabled
+func check_resolution() -> void:
+	if not ParentRef.ELEMENT_REFERENCE_TABLE_.has(\"Resolution\"):
+		return
+	
+	var ResolutionRef: SettingsElement =\\
+		ParentRef.ELEMENT_REFERENCE_TABLE_[\"Resolution\"]
+	
+	if currentValue != \"Windowed\":
+		ResolutionRef.OptionsRef.set_disabled(true)
+	else:
+		ResolutionRef.OptionsRef.set_disabled(false)
+
+
+# Called to scale the resolution to the provided percentage
+func adjust_resolution(sizeScale: float = 1.0) -> void:
+	var displaySize: Vector2i =\\
+		DisplayServer.screen_get_size(
+			DisplayServer.window_get_current_screen()
+		) * sizeScale
+	
+	get_window().set_size(displaySize)
+	get_viewport().set_size(displaySize)
+	get_window().move_to_center()
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="DisplayMode" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_duwn0")
+DEFAULT_VALUE = "Fullscreen"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "DisplayMode"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Display Mode"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/glow_quality.tscn

@@ -0,0 +1,55 @@
+[gd_scene load_steps=3 format=3 uid="uid://du5urp5d2dyjb"]
+
+[sub_resource type="GDScript" id="GDScript_7hlvr"]
+resource_name = "glow_quality"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = [
+		\"Disabled\",
+		\"Low\",
+		\"High\"
+	]
+
+
+func _apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+	
+	if currentValue == \"Disabled\":
+		return
+	
+	# Toggle bicubic upscaling
+	match currentValue:
+		\"Low\":
+			RenderingServer.environment_glow_set_use_bicubic_upscale(false)
+		\"High\":
+			RenderingServer.environment_glow_set_use_bicubic_upscale(true)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="GlowQuality" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_7hlvr")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "GlowQuality"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Glow Quality"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/max_fps.tscn

@@ -0,0 +1,85 @@
+[gd_scene load_steps=2 format=3 uid="uid://dghfxwcbi5ig"]
+
+[sub_resource type="GDScript" id="GDScript_eitn6"]
+resource_name = "max_fps"
+script/source = "extends SliderElement
+
+
+func init_element() -> void:
+	super.init_element()
+	# Increase UI max value by one for unlimited fps
+	SliderRef.set_max(MAX_VALUE + 1)
+	if ValueBoxRef is SpinBox:
+		ValueBoxRef.set_max(MAX_VALUE + 1)
+
+
+func load_settings() -> void:
+	super.load_settings()
+	if currentValue == 0:
+		ValueBoxRef.set_text(\"Unlimited\")
+		SliderRef.set_value(MAX_VALUE + 1)
+
+
+func value_changed(value: float) -> void:
+	if value > MAX_VALUE:
+		value = 0
+		ValueBoxRef.set_text(\"Unlimited\")
+	
+	super.value_changed(value)
+	
+
+
+# Element specific script for applying its value to the game
+func _apply_settings() -> void:
+	if (
+		ParentRef.ELEMENT_REFERENCE_TABLE_.has(\"VSync\")
+		and ParentRef.ELEMENT_REFERENCE_TABLE_[\"VSync\"].currentValue != \"Disabled\"
+	):
+		return
+	
+	Engine.set_max_fps(currentValue)
+"
+
+[node name="MaxFPS" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_eitn6")
+MIN_VALUE = 30.0
+MAX_VALUE = 240.0
+STEP_VALUE = 1.0
+DEFAULT_VALUE = 60.0
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "MaxFPS"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Max FPS"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="Label" parent="SliderValue"]
+custom_minimum_size = Vector2(80, 31)
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 1
+text = "240"
+horizontal_alignment = 2
+vertical_alignment = 1

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/resolution.tscn

@@ -0,0 +1,64 @@
+[gd_scene load_steps=2 format=3 uid="uid://cn8r63dmvd55c"]
+
+[sub_resource type="GDScript" id="GDScript_utf5l"]
+resource_name = "resolution"
+script/source = "extends OptionElement
+
+## Toggle window resizing by the user.
+@export var RESIZABLE: bool = false
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"3840x2160\": Vector2i(3840, 2160),
+		\"2560x1440\": Vector2i(2560, 1440),
+		\"1920x1080\": Vector2i(1920, 1080),
+		\"1280x720\": Vector2i(1280, 720),
+		\"960x540\": Vector2i(960, 540)
+	}
+
+
+func _ready() -> void:
+	super._ready()
+	# Toggle window resizing
+	DisplayServer.window_set_flag(
+		DisplayServer.WINDOW_FLAG_RESIZE_DISABLED,
+		!RESIZABLE
+	)
+
+
+func _apply_settings() -> void:
+	if DisplayServer.window_get_mode() == DisplayServer.WINDOW_MODE_EXCLUSIVE_FULLSCREEN:
+		return
+	
+	if DisplayServer.window_get_flag(DisplayServer.WINDOW_FLAG_BORDERLESS):
+		return
+	
+	# Change the window size to the selected resolution
+	get_window().set_size(OPTION_LIST_[currentValue])
+	get_viewport().set_size(OPTION_LIST_[currentValue])
+	get_window().move_to_center()
+"
+
+[node name="Resolution" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_utf5l")
+DEFAULT_VALUE = "1920x1080"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "Resolution"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Resolution"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler-sub-elements/fsr_mode.tscn

@@ -0,0 +1,41 @@
+[gd_scene load_steps=3 format=3 uid="uid://5dydkttc2fww"]
+
+[sub_resource type="GDScript" id="GDScript_usma2"]
+resource_name = "fsr_options"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Ultra Quality\": 0.77,
+		\"Quality\": 0.67,
+		\"Balanced\": 0.59,
+		\"Performance\": 0.5
+	}
+
+
+func _apply_settings() -> void:
+	get_viewport().set_scaling_3d_scale(OPTION_LIST_[currentValue])
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="FSRMode" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+size_flags_vertical = 3
+script = SubResource("GDScript_usma2")
+DEFAULT_VALUE = "Balanced"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "FSRMode"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "FSR Mode"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler-sub-elements/fsr_sharpness.tscn

@@ -0,0 +1,61 @@
+[gd_scene load_steps=4 format=3 uid="uid://bdoaqhvw440eh"]
+
+[sub_resource type="GDScript" id="GDScript_ng2w8"]
+resource_name = "fsr_sharpness"
+script/source = "extends SliderElement
+
+
+# Element specific script for applying its value to the game
+func _apply_settings() -> void:
+	get_viewport().set_fsr_sharpness((MAX_VALUE - currentValue) * 2.0)
+"
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hae3h"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_0xoq4"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hae3h")
+
+[node name="FSRSharpness" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_ng2w8")
+STEP_VALUE = 0.01
+DEFAULT_VALUE = 0.9
+DISPLAY_PERCENT_VALUE = true
+VALUE_SUFFIX = "%"
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "FSRSharpness"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "FSR Sharpness"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 20
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_0xoq4")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler-sub-elements/resolution_scale.tscn

@@ -0,0 +1,62 @@
+[gd_scene load_steps=4 format=3 uid="uid://ha87l3hl643g"]
+
+[sub_resource type="GDScript" id="GDScript_7dhl4"]
+resource_name = "resolution_scale"
+script/source = "extends SliderElement
+
+
+# Element specific script for applying its value to the game
+func _apply_settings() -> void:
+	get_viewport().set_scaling_3d_scale(currentValue)
+"
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hae3h"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_0xoq4"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hae3h")
+
+[node name="ResolutionScale" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_7dhl4")
+MIN_VALUE = 0.5
+MAX_VALUE = 2.0
+STEP_VALUE = 0.01
+DISPLAY_PERCENT_VALUE = true
+VALUE_SUFFIX = "%"
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "ResolutionScale"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Resolution Scale"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 20
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_0xoq4")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler.tscn

@@ -0,0 +1,128 @@
+[gd_scene format=3 uid="uid://b3w7qpn4nhmu2"]
+
+[ext_resource type="PackedScene" uid="uid://ha87l3hl643g" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler-sub-elements/resolution_scale.tscn" id="1_4irey"]
+[ext_resource type="PackedScene" uid="uid://5dydkttc2fww" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler-sub-elements/fsr_mode.tscn" id="2_w65g1"]
+[ext_resource type="PackedScene" uid="uid://bdoaqhvw440eh" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler-sub-elements/fsr_sharpness.tscn" id="3_v8pix"]
+
+[sub_resource type="GDScript" id="GDScript_bn0b0"]
+resource_name = "scaler"
+script/source = "extends MultiElement
+
+
+func _display_sub_elements() -> void:
+	match currentValue:
+		\"Disabled\":
+			for element in SUB_ELEMENTS_:
+				element.hide()
+		\"Bilinear\":
+			SUB_ELEMENTS_[0].show()
+			SUB_ELEMENTS_[1].hide()
+			SUB_ELEMENTS_[2].hide()
+		\"FSR 2.2\":
+			SUB_ELEMENTS_[0].hide()
+			SUB_ELEMENTS_[1].show()
+			SUB_ELEMENTS_[2].show()
+"
+
+[sub_resource type="GDScript" id="GDScript_mdyud"]
+resource_name = "scaling_mode"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Disabled\": Viewport.SCALING_3D_MODE_BILINEAR,
+		\"Bilinear\": Viewport.SCALING_3D_MODE_BILINEAR,
+		\"FSR 2.2\": Viewport.SCALING_3D_MODE_FSR2
+	}
+
+
+# Loads the saved/default values of the element
+func load_settings() -> void:
+	super.load_settings()
+	# Check if TAA is selected
+	call_deferred(\"check_anti_aliasing\")
+
+
+func option_selected(index: int) -> void:
+	super.option_selected(index)
+	# Check if TAA is selected
+	check_anti_aliasing()
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	get_viewport().set_scaling_3d_mode(OPTION_LIST_[currentValue])
+	if currentValue == \"Disabled\":
+		get_viewport().set_scaling_3d_scale(1.0)
+
+
+# Checks if TAA is selected while FSR 2.2 is enabled
+func check_anti_aliasing() -> void:
+	if not ParentRef.ELEMENT_REFERENCE_TABLE_.has(\"AntiAliasing\"):
+		return
+	
+	var AntiAliasingRef: SettingsElement =\\
+		ParentRef.ELEMENT_REFERENCE_TABLE_[\"AntiAliasing\"]
+	var taaIndex: int = AntiAliasingRef.OPTION_LIST_.find(\"TAA\")
+	
+	if currentValue != \"FSR 2.2\":
+		AntiAliasingRef.OptionsRef.set_item_disabled(
+			taaIndex,
+			false
+		)
+		return
+	
+	AntiAliasingRef.OptionsRef.set_item_disabled(
+		taaIndex,
+		true
+	)
+	if AntiAliasingRef.currentValue == \"TAA\":
+		var disabledIndex: int = AntiAliasingRef.OPTION_LIST_.find(\"Disabled\")
+		# Reselect the anti aliasing mode
+		AntiAliasingRef.OptionsRef.select(disabledIndex)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="Scaler" type="VBoxContainer" node_paths=PackedStringArray("MainElementRef", "SUB_ELEMENTS_")]
+offset_top = 51.0
+offset_right = 1152.0
+offset_bottom = 51.0
+script = SubResource("GDScript_bn0b0")
+MainElementRef = NodePath("ScalingMode")
+SUB_ELEMENTS_ = [NodePath("ResolutionScale"), NodePath("FSRMode"), NodePath("FSRSharpness")]
+
+[node name="ScalingMode" type="HBoxContainer" parent="." node_paths=PackedStringArray("OptionsRef")]
+layout_mode = 2
+size_flags_horizontal = 3
+script = SubResource("GDScript_mdyud")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "ScalingMode"
+
+[node name="Label" type="Label" parent="ScalingMode"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Scaling Mode"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="ScalingMode"]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")
+
+[node name="ResolutionScale" parent="." instance=ExtResource("1_4irey")]
+visible = false
+layout_mode = 2
+size_flags_vertical = 3
+
+[node name="FSRMode" parent="." instance=ExtResource("2_w65g1")]
+visible = false
+layout_mode = 2
+
+[node name="FSRSharpness" parent="." instance=ExtResource("3_v8pix")]
+visible = false
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/sdfgi_quality.tscn

@@ -0,0 +1,53 @@
+[gd_scene load_steps=3 format=3 uid="uid://ddykljx6ndodi"]
+
+[sub_resource type="GDScript" id="GDScript_6k8bu"]
+resource_name = "sdfgi_quality"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Disabled\": null,
+		\"Low\": RenderingServer.ENV_SDFGI_RAY_COUNT_8,
+		\"Medium\": RenderingServer.ENV_SDFGI_RAY_COUNT_32,
+		\"High\": RenderingServer.ENV_SDFGI_RAY_COUNT_96
+	}
+
+
+# Called to apply the settings in the settings cache
+func apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+	
+	if currentValue == \"Disabled\":
+		return
+	
+	RenderingServer.environment_set_sdfgi_ray_count(OPTION_LIST_[currentValue])
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="SDFGIQuality" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+tooltip_text = "Signed Distance Field Global Illumination"
+script = SubResource("GDScript_6k8bu")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "SDFGIQuality"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "SDFGI Quality"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/shadow_quality.tscn

@@ -0,0 +1,50 @@
+[gd_scene load_steps=3 format=3 uid="uid://cgqiotob5aaoq"]
+
+[sub_resource type="GDScript" id="GDScript_v3ktk"]
+resource_name = "shadow_quality"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Low\": RenderingServer.SHADOW_QUALITY_SOFT_LOW,
+		\"Medium\": RenderingServer.SHADOW_QUALITY_SOFT_MEDIUM,
+		\"High\": RenderingServer.SHADOW_QUALITY_SOFT_HIGH
+	}
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	RenderingServer.directional_soft_shadow_filter_set_quality(
+		OPTION_LIST_[currentValue]
+	)
+	RenderingServer.positional_soft_shadow_filter_set_quality(
+		OPTION_LIST_[currentValue]
+	)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="ShadowQuality" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_v3ktk")
+DEFAULT_VALUE = "Low"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "ShadowQuality"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Shadow Quality"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/ssao_quality.tscn

@@ -0,0 +1,78 @@
+[gd_scene load_steps=3 format=3 uid="uid://bk5ky60jln7ag"]
+
+[sub_resource type="GDScript" id="GDScript_h10e0"]
+resource_name = "ssao_quality"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Disabled\": null,
+		\"Low\": {
+			\"quality\": RenderingServer.ENV_SSAO_QUALITY_LOW,
+			\"halfSize\": true,
+			\"blurPasses\": 1,
+			\"fadeOutFrom\": 25,
+			\"fadeOutTo\": 150
+		},
+		\"Medium\": {
+			\"quality\": RenderingServer.ENV_SSAO_QUALITY_MEDIUM,
+			\"halfSize\": true,
+			\"blurPasses\": 2,
+			\"fadeOutFrom\": 50,
+			\"fadeOutTo\": 300
+		},
+		\"High\": {
+			\"quality\": RenderingServer.ENV_SSAO_QUALITY_HIGH,
+			\"halfSize\": false,
+			\"blurPasses\": 4,
+			\"fadeOutFrom\": 100,
+			\"fadeOutTo\": 600
+		}
+	}
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+	
+	if currentValue == \"Disabled\":
+		return
+	
+	RenderingServer.environment_set_ssao_quality(
+		OPTION_LIST_[currentValue][\"quality\"], 
+		OPTION_LIST_[currentValue][\"halfSize\"], 
+		0.5, 
+		OPTION_LIST_[currentValue][\"blurPasses\"], 
+		OPTION_LIST_[currentValue][\"fadeOutFrom\"], 
+		OPTION_LIST_[currentValue][\"fadeOutTo\"]
+	)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="SSAOQuality" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+tooltip_text = "Screen Space Ambient Occlusion"
+script = SubResource("GDScript_h10e0")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "SSAOQuality"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "SSAO Quality"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/ssil_quality.tscn

@@ -0,0 +1,78 @@
+[gd_scene load_steps=3 format=3 uid="uid://bmnvig4gfqj0c"]
+
+[sub_resource type="GDScript" id="GDScript_fwd72"]
+resource_name = "ssil_quality"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Disabled\": null,
+		\"Low\": {
+			\"quality\": RenderingServer.ENV_SSIL_QUALITY_LOW,
+			\"halfSize\": true,
+			\"blurPasses\": 2,
+			\"fadeOutFrom\": 25,
+			\"fadeOutTo\": 150
+		},
+		\"Medium\": {
+			\"quality\": RenderingServer.ENV_SSIL_QUALITY_MEDIUM,
+			\"halfSize\": true,
+			\"blurPasses\": 4,
+			\"fadeOutFrom\": 50,
+			\"fadeOutTo\": 300
+		},
+		\"High\": {
+			\"quality\": RenderingServer.ENV_SSIL_QUALITY_HIGH,
+			\"halfSize\": false,
+			\"blurPasses\": 8,
+			\"fadeOutFrom\": 100,
+			\"fadeOutTo\": 600
+		}
+	}
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	apply_in_game_setting(currentValue)
+	
+	if currentValue == \"Disabled\":
+		return
+	
+	RenderingServer.environment_set_ssil_quality(
+		OPTION_LIST_[currentValue][\"quality\"], 
+		OPTION_LIST_[currentValue][\"halfSize\"], 
+		0.5, 
+		OPTION_LIST_[currentValue][\"blurPasses\"], 
+		OPTION_LIST_[currentValue][\"fadeOutFrom\"], 
+		OPTION_LIST_[currentValue][\"fadeOutTo\"]
+	)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="SSILQuality" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+tooltip_text = "Screen Space Indirect Lighting"
+script = SubResource("GDScript_fwd72")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "SSILQuality"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "SSIL Quality"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/ssr_quality.tscn

@@ -0,0 +1,70 @@
+[gd_scene load_steps=3 format=3 uid="uid://cqfr01uk73ce5"]
+
+[sub_resource type="GDScript" id="GDScript_v8qca"]
+resource_name = "ssr_quality"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+	\"Disabled\": null,
+	\"Low\": {
+		\"roughnessQuality\": RenderingServer.ENV_SSR_ROUGHNESS_QUALITY_LOW,
+		\"maxSteps\": 32,
+		\"fadeIn\": 0.3,
+		\"fadeOut\": 1.0
+	},
+	\"Medium\": {
+		\"roughnessQuality\": RenderingServer.ENV_SSR_ROUGHNESS_QUALITY_MEDIUM,
+		\"maxSteps\": 64,
+		\"fadeIn\": 0.15,
+		\"fadeOut\": 2.0
+	},
+	\"High\": {
+		\"roughnessQuality\": RenderingServer.ENV_SSR_ROUGHNESS_QUALITY_HIGH,
+		\"maxSteps\": 128,
+		\"fadeIn\": 0.075,
+		\"fadeOut\": 4.0
+	}
+}
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	apply_in_game_setting(OPTION_LIST_[currentValue])
+	
+	if currentValue == \"Disabled\":
+		return
+	
+	RenderingServer.environment_set_ssr_roughness_quality(
+		OPTION_LIST_[currentValue][\"roughnessQuality\"]
+	)
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="SSRQuality" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+tooltip_text = "Screen Space Reflection"
+script = SubResource("GDScript_v8qca")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "SSRQuality"
+IS_IN_GAME_SETTING = true
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "SSR Quality"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/graphics-elements/vsync.tscn

@@ -0,0 +1,96 @@
+[gd_scene load_steps=3 format=3 uid="uid://idtbqnsqlvb6"]
+
+[sub_resource type="GDScript" id="GDScript_kwfgn"]
+resource_name = "vsync"
+script/source = "extends OptionElement
+
+
+func _init() -> void:
+	OPTION_LIST_ = {
+	\"Disabled\": DisplayServer.VSYNC_DISABLED,
+	\"Enabled\": DisplayServer.VSYNC_ENABLED,
+	\"Adaptive\": DisplayServer.VSYNC_ADAPTIVE
+}
+
+
+# Loads the saved/default values of the element
+func load_settings() -> void:
+	super.load_settings()
+	# Toggle the max fps element
+	call_deferred(\"toggle_max_fps\")
+
+
+func option_selected(index: int) -> void:
+	super.option_selected(index)
+	# Toggle the max fps element
+	toggle_max_fps()
+
+
+# Called to apply the settings in the settings cache
+func _apply_settings() -> void:
+	# Set the vsync mode to the selected option
+	DisplayServer.window_set_vsync_mode(OPTION_LIST_[currentValue])
+	
+	# Set the max fps to unlimited if vsync is being enabled
+	if currentValue != \"Disabled\":
+		Engine.set_max_fps(0)
+	
+	# Check if the max fps element exists and if vsync is disabled
+	if (
+		ParentRef.ELEMENT_REFERENCE_TABLE_.has(\"MaxFPS\")
+		and currentValue == \"Disabled\"
+	):
+		# Check if max fps has been changed
+		if not ParentRef.changedElements_.has(\"MaxFPS\"):
+			# Apply the max fps settings manually
+			ParentRef.ELEMENT_REFERENCE_TABLE_[\"MaxFPS\"]._apply_settings()
+	elif currentValue == \"Disabled\":
+		# Set the max fps to the max fps read from the project settings
+		Engine.set_max_fps(ProjectSettings.get_setting(\"application/run/max_fps\"))
+	
+
+
+# Disable/Enable the max fps element according to if vsync is on or not
+func toggle_max_fps() -> void:
+	if not ParentRef.ELEMENT_REFERENCE_TABLE_.has(\"MaxFPS\"):
+		return
+	
+	# Reference to the slider value node of the max fps element
+	var MaxFpsRef: SettingsElement =\\
+		ParentRef.ELEMENT_REFERENCE_TABLE_[\"MaxFPS\"]
+	
+	if currentValue == \"Disabled\":
+		# Enable the max fps element
+		MaxFpsRef.SliderRef.set_editable(true)
+		MaxFpsRef.ValueBoxRef.modulate = Color.WHITE
+	else:
+		# Disable the max fps element
+		MaxFpsRef.SliderRef.set_editable(false)
+		MaxFpsRef.ValueBoxRef.modulate = Color.GRAY
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="VSync" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_kwfgn")
+DEFAULT_VALUE = "Disabled"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "VSync"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "V-Sync"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/element-panel-template/button_element_template.tscn

@@ -0,0 +1,14 @@
+[gd_scene format=3 uid="uid://d0rkws47yf8l2"]
+
+[ext_resource type="Script" uid="uid://d3nlqtnyyndrg" path="res://addons/modular-settings-menu/scripts/base-settings-elements/button_element.gd" id="1_cnjcn"]
+[ext_resource type="PackedScene" uid="uid://cwhs0kpipkxfv" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/element-panel-template/element_panel_template.tscn" id="2_gbpfn"]
+
+[node name="ButtonElementTemplate" type="Button"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+text = "Button Element"
+script = ExtResource("1_cnjcn")
+ElementPanelScene = ExtResource("2_gbpfn")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/element-panel-template/element_panel_template.tscn

@@ -0,0 +1,76 @@
+[gd_scene format=3 uid="uid://cwhs0kpipkxfv"]
+
+[ext_resource type="Script" uid="uid://cyig515shrgnb" path="res://addons/modular-settings-menu/scripts/element_panel.gd" id="1_3f2r5"]
+[ext_resource type="PackedScene" uid="uid://bjcuw6amean2" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/slider_element_template.tscn" id="2_fpsnu"]
+
+[node name="ElementPanelTemplate" type="Control"]
+layout_mode = 3
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = ExtResource("1_3f2r5")
+IDENTIFIER = "PanelTemplate"
+
+[node name="VBoxContainer" type="VBoxContainer" parent="."]
+layout_mode = 1
+anchors_preset = 8
+anchor_left = 0.5
+anchor_top = 0.5
+anchor_right = 0.5
+anchor_bottom = 0.5
+offset_left = -194.0
+offset_top = -29.0
+offset_right = 194.0
+offset_bottom = 30.0
+grow_horizontal = 2
+grow_vertical = 2
+
+[node name="PanelContainer" type="PanelContainer" parent="VBoxContainer"]
+custom_minimum_size = Vector2(0, 280)
+layout_mode = 2
+
+[node name="MarginContainer" type="MarginContainer" parent="VBoxContainer/PanelContainer"]
+layout_mode = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ScrollContainer" type="ScrollContainer" parent="VBoxContainer/PanelContainer/MarginContainer"]
+layout_mode = 2
+size_flags_vertical = 3
+
+[node name="MarginContainer" type="MarginContainer" parent="VBoxContainer/PanelContainer/MarginContainer/ScrollContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ElementList" type="VBoxContainer" parent="VBoxContainer/PanelContainer/MarginContainer/ScrollContainer/MarginContainer"]
+layout_mode = 2
+
+[node name="SliderElementTemplate" parent="VBoxContainer/PanelContainer/MarginContainer/ScrollContainer/MarginContainer/ElementList" instance=ExtResource("2_fpsnu")]
+layout_mode = 2
+
+[node name="HBoxContainer" type="HBoxContainer" parent="VBoxContainer"]
+layout_mode = 2
+
+[node name="ApplyButton" type="Button" parent="VBoxContainer/HBoxContainer"]
+layout_direction = 1
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+disabled = true
+text = "Apply"
+
+[node name="BackButton" type="Button" parent="VBoxContainer/HBoxContainer"]
+layout_direction = 1
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+text = "Back"

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/multi-element-template/main_element.tscn

@@ -0,0 +1,46 @@
+[gd_scene load_steps=3 format=3 uid="uid://vlmvkci3ptii"]
+
+[sub_resource type="GDScript" id="GDScript_sk6j2"]
+resource_name = "option_element_template"
+script/source = "extends OptionElement
+
+
+# Provide the options for the element
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"None\": null,
+		\"Slider\": null,
+		\"Toggle\": null
+	}
+
+
+# Called to apply the setting to the game
+func _apply_settings() -> void:
+	pass
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="MainElement" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_sk6j2")
+DEFAULT_VALUE = "None"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "MainElement"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Option Element"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/multi-element-template/multi_element_template.tscn

@@ -0,0 +1,43 @@
+[gd_scene format=3 uid="uid://csr6kawyf3t3i"]
+
+[ext_resource type="PackedScene" uid="uid://vlmvkci3ptii" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/multi-element-template/main_element.tscn" id="1_mhqaj"]
+[ext_resource type="PackedScene" uid="uid://bjcuw6amean2" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/slider_element_template.tscn" id="2_mf8gn"]
+[ext_resource type="PackedScene" uid="uid://cxaxyqer0af21" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/toggle_element_template.tscn" id="3_gs1f8"]
+
+[sub_resource type="GDScript" id="GDScript_sk6j2"]
+resource_name = "multi_element_template"
+script/source = "extends MultiElement
+
+
+func _display_sub_elements() -> void:
+	match currentValue:
+		\"None\":
+			for element in SUB_ELEMENTS_:
+				element.hide()
+		\"Slider\":
+			SUB_ELEMENTS_[0].show()
+			SUB_ELEMENTS_[1].hide()
+		\"Toggle\":
+			SUB_ELEMENTS_[0].hide()
+			SUB_ELEMENTS_[1].show()
+"
+
+[node name="MultiElementTemplate" type="VBoxContainer" node_paths=PackedStringArray("MainElementRef", "SUB_ELEMENTS_")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+size_flags_horizontal = 3
+script = SubResource("GDScript_sk6j2")
+MainElementRef = NodePath("MainElement")
+SUB_ELEMENTS_ = [NodePath("SliderElementTemplate"), NodePath("ToggleElementTemplate")]
+
+[node name="MainElement" parent="." instance=ExtResource("1_mhqaj")]
+layout_mode = 2
+
+[node name="SliderElementTemplate" parent="." instance=ExtResource("2_mf8gn")]
+layout_mode = 2
+
+[node name="ToggleElementTemplate" parent="." instance=ExtResource("3_gs1f8")]
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/option_element_template.tscn

@@ -0,0 +1,44 @@
+[gd_scene load_steps=3 format=3 uid="uid://dc1yif146sxav"]
+
+[sub_resource type="GDScript" id="GDScript_sk6j2"]
+resource_name = "option_element_template"
+script/source = "extends OptionElement
+
+
+# Provide the options for the element
+func _init() -> void:
+	OPTION_LIST_ = {
+		\"Example\": null
+	}
+
+
+# Called to apply the setting to the game
+func _apply_settings() -> void:
+	pass
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="OptionElementTemplate" type="HBoxContainer" node_paths=PackedStringArray("OptionsRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_sk6j2")
+DEFAULT_VALUE = "Example"
+OptionsRef = NodePath("Options")
+IDENTIFIER = "OptionTemplate"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Option Element"
+vertical_alignment = 1
+
+[node name="Options" type="OptionButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/section_template.tscn

@@ -0,0 +1,78 @@
+[gd_scene format=3 uid="uid://ejplmui1twn4"]
+
+[ext_resource type="Script" uid="uid://c3ssroxjs8wt" path="res://addons/modular-settings-menu/scripts/settings_section.gd" id="1_aglse"]
+[ext_resource type="PackedScene" uid="uid://dc1yif146sxav" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/option_element_template.tscn" id="2_ws4gk"]
+[ext_resource type="PackedScene" uid="uid://csr6kawyf3t3i" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/multi-element-template/multi_element_template.tscn" id="2_xre3j"]
+[ext_resource type="PackedScene" uid="uid://bjcuw6amean2" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/slider_element_template.tscn" id="3_o11e6"]
+[ext_resource type="PackedScene" uid="uid://cxaxyqer0af21" path="res://addons/modular-settings-menu/scenes/settings-elements/templates/toggle_element_template.tscn" id="4_41mog"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_e0spm"]
+
+[node name="SectionTemplate" type="TabBar"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_styles/tab_focus = SubResource("StyleBoxEmpty_e0spm")
+script = ExtResource("1_aglse")
+IDENTIFIER = "ExampleSection"
+
+[node name="MarginContainer" type="MarginContainer" parent="."]
+layout_mode = 1
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ScrollContainer" type="ScrollContainer" parent="MarginContainer"]
+layout_mode = 2
+horizontal_scroll_mode = 0
+
+[node name="MarginContainer" type="MarginContainer" parent="MarginContainer/ScrollContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ElementList" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/separation = 24
+
+[node name="ParentElementTemplate" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList" instance=ExtResource("2_xre3j")]
+layout_mode = 2
+
+[node name="SubSection" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/SubSection"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "Sub Section"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/SubSection"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/SubSection"]
+layout_mode = 2
+
+[node name="OptionElementTemplate" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/SubSection/SubSectionElements" instance=ExtResource("2_ws4gk")]
+layout_mode = 2
+
+[node name="SliderElementTemplate" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/SubSection/SubSectionElements" instance=ExtResource("3_o11e6")]
+layout_mode = 2
+
+[node name="ToggleElementTemplate" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/SubSection/SubSectionElements" instance=ExtResource("4_41mog")]
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/slider_element_template.tscn

@@ -0,0 +1,57 @@
+[gd_scene load_steps=4 format=3 uid="uid://bjcuw6amean2"]
+
+[sub_resource type="GDScript" id="GDScript_i57rt"]
+resource_name = "slider_element_template"
+script/source = "extends SliderElement
+
+
+# Called to apply the setting to the game
+func _apply_settings() -> void:
+	pass
+"
+
+[sub_resource type="PlaceholderTexture2D" id="PlaceholderTexture2D_hlot4"]
+size = Vector2(0, 0)
+
+[sub_resource type="Theme" id="Theme_4i2xw"]
+SpinBox/icons/updown = SubResource("PlaceholderTexture2D_hlot4")
+
+[node name="SliderElementTemplate" type="HBoxContainer" node_paths=PackedStringArray("SliderRef", "ValueBoxRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_i57rt")
+SliderRef = NodePath("SliderValue/Slider")
+ValueBoxRef = NodePath("SliderValue/Value")
+IDENTIFIER = "SliderTemplate"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Slider Element"
+vertical_alignment = 1
+
+[node name="SliderValue" type="HBoxContainer" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_constants/separation = 6
+
+[node name="Slider" type="HSlider" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+max_value = 0.0
+step = 0.0
+ticks_on_borders = true
+
+[node name="Value" type="SpinBox" parent="SliderValue"]
+layout_mode = 2
+size_flags_horizontal = 8
+size_flags_vertical = 4
+theme = SubResource("Theme_4i2xw")
+max_value = 0.0
+step = 0.0
+alignment = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-elements/templates/toggle_element_template.tscn

@@ -0,0 +1,36 @@
+[gd_scene load_steps=3 format=3 uid="uid://cxaxyqer0af21"]
+
+[sub_resource type="GDScript" id="GDScript_bpxmf"]
+resource_name = "toggle_element_template"
+script/source = "extends ToggleElement
+
+
+# Called to apply the setting to the game
+func _apply_settings() -> void:
+	pass
+"
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_drjjf"]
+
+[node name="ToggleElementTemplate" type="HBoxContainer" node_paths=PackedStringArray("ToggleRef")]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+script = SubResource("GDScript_bpxmf")
+ToggleRef = NodePath("Toggle")
+IDENTIFIER = "ToggleTemplate"
+
+[node name="Label" type="Label" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 1
+text = "Toggle Element"
+vertical_alignment = 1
+
+[node name="Toggle" type="CheckButton" parent="."]
+layout_mode = 2
+size_flags_horizontal = 3
+focus_mode = 0
+theme_override_styles/focus = SubResource("StyleBoxEmpty_drjjf")

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-sections/audio.tscn

@@ -0,0 +1,74 @@
+[gd_scene format=3 uid="uid://y5oxvao3aqtb"]
+
+[ext_resource type="Script" uid="uid://c3ssroxjs8wt" path="res://addons/modular-settings-menu/scripts/settings_section.gd" id="1_e0sxq"]
+[ext_resource type="PackedScene" uid="uid://pir75xaw2g08" path="res://addons/modular-settings-menu/scenes/settings-elements/audio-elements/master_volume.tscn" id="2_l5q4d"]
+[ext_resource type="PackedScene" uid="uid://y6kuxwyem48c" path="res://addons/modular-settings-menu/scenes/settings-elements/audio-elements/music_volume.tscn" id="3_v08xa"]
+[ext_resource type="PackedScene" uid="uid://jl3iirunm0hq" path="res://addons/modular-settings-menu/scenes/settings-elements/audio-elements/sfx_volume.tscn" id="4_j1ron"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_e0spm"]
+
+[node name="Audio" type="TabBar"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_styles/tab_focus = SubResource("StyleBoxEmpty_e0spm")
+script = ExtResource("1_e0sxq")
+IDENTIFIER = "Audio"
+
+[node name="MarginContainer" type="MarginContainer" parent="."]
+layout_mode = 1
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ScrollContainer" type="ScrollContainer" parent="MarginContainer"]
+layout_mode = 2
+horizontal_scroll_mode = 0
+
+[node name="MarginContainer" type="MarginContainer" parent="MarginContainer/ScrollContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ElementList" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/separation = 24
+
+[node name="VolumeSettings" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/VolumeSettings"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "Volume Settings"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/VolumeSettings"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/VolumeSettings"]
+layout_mode = 2
+
+[node name="MasterVolume" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/VolumeSettings/SubSectionElements" instance=ExtResource("2_l5q4d")]
+layout_mode = 2
+
+[node name="MusicVolume" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/VolumeSettings/SubSectionElements" instance=ExtResource("3_v08xa")]
+layout_mode = 2
+
+[node name="SFXVolume" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/VolumeSettings/SubSectionElements" instance=ExtResource("4_j1ron")]
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-sections/controls.tscn

@@ -0,0 +1,86 @@
+[gd_scene format=3 uid="uid://dfswr81erouhj"]
+
+[ext_resource type="Script" uid="uid://c3ssroxjs8wt" path="res://addons/modular-settings-menu/scripts/settings_section.gd" id="1_vmore"]
+[ext_resource type="PackedScene" uid="uid://cy8n6yalxprb7" path="res://addons/modular-settings-menu/scenes/settings-elements/controls-elements/sensitivity.tscn" id="2_qcqml"]
+[ext_resource type="PackedScene" uid="uid://c2tgt7fu0n5wp" path="res://addons/modular-settings-menu/scenes/settings-elements/controls-elements/invert_y.tscn" id="3_8np8q"]
+[ext_resource type="PackedScene" uid="uid://i0w5gftb0j16" path="res://addons/modular-settings-menu/scenes/settings-elements/controls-elements/input_settings.tscn" id="4_bejag"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_e0spm"]
+
+[node name="Controls" type="TabBar"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_styles/tab_focus = SubResource("StyleBoxEmpty_e0spm")
+script = ExtResource("1_vmore")
+IDENTIFIER = "Controls"
+
+[node name="MarginContainer" type="MarginContainer" parent="."]
+layout_mode = 1
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ScrollContainer" type="ScrollContainer" parent="MarginContainer"]
+layout_mode = 2
+horizontal_scroll_mode = 0
+
+[node name="MarginContainer" type="MarginContainer" parent="MarginContainer/ScrollContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ElementList" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/separation = 24
+
+[node name="MouseSettings" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/MouseSettings"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "Mouse Settings"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/MouseSettings"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/MouseSettings"]
+layout_mode = 2
+
+[node name="Sensitivity" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/MouseSettings/SubSectionElements" instance=ExtResource("2_qcqml")]
+layout_mode = 2
+
+[node name="InvertY" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/MouseSettings/SubSectionElements" instance=ExtResource("3_8np8q")]
+layout_mode = 2
+
+[node name="KeyboardSettings" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/KeyboardSettings"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "Keyboard Settings"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/KeyboardSettings"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/KeyboardSettings"]
+layout_mode = 2
+
+[node name="InputSettings" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/KeyboardSettings/SubSectionElements" instance=ExtResource("4_bejag")]
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-sections/gameplay.tscn

@@ -0,0 +1,66 @@
+[gd_scene format=3 uid="uid://c66v42g6gs7gr"]
+
+[ext_resource type="Script" uid="uid://c3ssroxjs8wt" path="res://addons/modular-settings-menu/scripts/settings_section.gd" id="1_i11k5"]
+[ext_resource type="PackedScene" uid="uid://elu1vc0ox472" path="res://addons/modular-settings-menu/scenes/settings-elements/gameplay-elements/fov.tscn" id="2_c8t76"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_e0spm"]
+
+[node name="Gameplay" type="TabBar"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_styles/tab_focus = SubResource("StyleBoxEmpty_e0spm")
+script = ExtResource("1_i11k5")
+IDENTIFIER = "Gameplay"
+
+[node name="MarginContainer" type="MarginContainer" parent="."]
+layout_mode = 1
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ScrollContainer" type="ScrollContainer" parent="MarginContainer"]
+layout_mode = 2
+horizontal_scroll_mode = 0
+
+[node name="MarginContainer" type="MarginContainer" parent="MarginContainer/ScrollContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ElementList" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/separation = 24
+
+[node name="GeneralSettings" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/GeneralSettings"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "General Settings"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/GeneralSettings"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/GeneralSettings"]
+layout_mode = 2
+
+[node name="FOV" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/GeneralSettings/SubSectionElements" instance=ExtResource("2_c8t76")]
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings-sections/graphics.tscn

@@ -0,0 +1,129 @@
+[gd_scene format=3 uid="uid://buqq0kms2dbb4"]
+
+[ext_resource type="Script" uid="uid://c3ssroxjs8wt" path="res://addons/modular-settings-menu/scripts/settings_section.gd" id="1_704sp"]
+[ext_resource type="PackedScene" uid="uid://byff0jwaicxvr" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/display_mode.tscn" id="1_mr6e7"]
+[ext_resource type="PackedScene" uid="uid://cn8r63dmvd55c" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/resolution.tscn" id="2_5bpi0"]
+[ext_resource type="PackedScene" uid="uid://b3w7qpn4nhmu2" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/scaler.tscn" id="4_g2t2s"]
+[ext_resource type="PackedScene" uid="uid://dghfxwcbi5ig" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/max_fps.tscn" id="5_82fyi"]
+[ext_resource type="PackedScene" uid="uid://idtbqnsqlvb6" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/vsync.tscn" id="6_2rh1a"]
+[ext_resource type="PackedScene" uid="uid://csg6c3uuct1ls" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/anti_aliasing.tscn" id="7_r8hxv"]
+[ext_resource type="PackedScene" uid="uid://3ckate3v614f" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/depth_of_field.tscn" id="8_28f8l"]
+[ext_resource type="PackedScene" uid="uid://cgqiotob5aaoq" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/shadow_quality.tscn" id="9_1x78v"]
+[ext_resource type="PackedScene" uid="uid://cqfr01uk73ce5" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/ssr_quality.tscn" id="10_cfuis"]
+[ext_resource type="PackedScene" uid="uid://du5urp5d2dyjb" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/glow_quality.tscn" id="10_m0pim"]
+[ext_resource type="PackedScene" uid="uid://bk5ky60jln7ag" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/ssao_quality.tscn" id="11_xa1gl"]
+[ext_resource type="PackedScene" uid="uid://bmnvig4gfqj0c" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/ssil_quality.tscn" id="12_jqvyp"]
+[ext_resource type="PackedScene" uid="uid://ddykljx6ndodi" path="res://addons/modular-settings-menu/scenes/settings-elements/graphics-elements/sdfgi_quality.tscn" id="13_ifeh4"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_v0fou"]
+
+[node name="Graphics" type="TabBar"]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_styles/tab_focus = SubResource("StyleBoxEmpty_v0fou")
+script = ExtResource("1_704sp")
+IDENTIFIER = "Graphics"
+
+[node name="MarginContainer" type="MarginContainer" parent="."]
+layout_mode = 1
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ScrollContainer" type="ScrollContainer" parent="MarginContainer"]
+layout_mode = 2
+horizontal_scroll_mode = 0
+
+[node name="MarginContainer" type="MarginContainer" parent="MarginContainer/ScrollContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/margin_left = 8
+theme_override_constants/margin_top = 8
+theme_override_constants/margin_right = 8
+theme_override_constants/margin_bottom = 8
+
+[node name="ElementList" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer"]
+layout_mode = 2
+size_flags_horizontal = 3
+size_flags_vertical = 3
+theme_override_constants/separation = 24
+
+[node name="BasicSettings" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/BasicSettings"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "Basic Settings"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/BasicSettings"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/BasicSettings"]
+layout_mode = 2
+
+[node name="DisplayMode" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/BasicSettings/SubSectionElements" instance=ExtResource("1_mr6e7")]
+layout_mode = 2
+defaultValue = "Windowed"
+
+[node name="Resolution" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/BasicSettings/SubSectionElements" instance=ExtResource("2_5bpi0")]
+layout_mode = 2
+defaultValue = "1280x720"
+
+[node name="MaxFPS" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/BasicSettings/SubSectionElements" instance=ExtResource("5_82fyi")]
+layout_mode = 2
+
+[node name="AdvancedSettings" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList"]
+layout_mode = 2
+
+[node name="SubSectionName" type="Label" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings"]
+layout_mode = 2
+theme_override_font_sizes/font_size = 20
+text = "Advanced Settings
+"
+
+[node name="HSeparator" type="HSeparator" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings"]
+layout_mode = 2
+
+[node name="SubSectionElements" type="VBoxContainer" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings"]
+layout_mode = 2
+
+[node name="Scaler" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("4_g2t2s")]
+layout_mode = 2
+
+[node name="AntiAliasing" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("7_r8hxv")]
+layout_mode = 2
+
+[node name="VSync" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("6_2rh1a")]
+layout_mode = 2
+
+[node name="DepthOfField" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("8_28f8l")]
+layout_mode = 2
+
+[node name="ShadowQuality" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("9_1x78v")]
+layout_mode = 2
+
+[node name="GlowQuality" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("10_m0pim")]
+layout_mode = 2
+
+[node name="SSRQuality" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("10_cfuis")]
+layout_mode = 2
+
+[node name="SSAOQuality" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("11_xa1gl")]
+layout_mode = 2
+
+[node name="SSILQuality" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("12_jqvyp")]
+layout_mode = 2
+
+[node name="SDFGIQuality" parent="MarginContainer/ScrollContainer/MarginContainer/ElementList/AdvancedSettings/SubSectionElements" instance=ExtResource("13_ifeh4")]
+layout_mode = 2

evolve-die-repeat/addons/modular-settings-menu/scenes/settings.tscn

@@ -0,0 +1,97 @@
+[gd_scene format=3 uid="uid://px6a2dg8cawb"]
+
+[ext_resource type="Script" uid="uid://houdhjao14e7" path="res://addons/modular-settings-menu/scripts/settings_menu.gd" id="1_crapp"]
+[ext_resource type="PackedScene" uid="uid://c66v42g6gs7gr" path="res://addons/modular-settings-menu/scenes/settings-sections/gameplay.tscn" id="2_kjxrg"]
+[ext_resource type="PackedScene" uid="uid://buqq0kms2dbb4" path="res://addons/modular-settings-menu/scenes/settings-sections/graphics.tscn" id="3_8fcn6"]
+[ext_resource type="PackedScene" uid="uid://dfswr81erouhj" path="res://addons/modular-settings-menu/scenes/settings-sections/controls.tscn" id="4_3a4pu"]
+[ext_resource type="PackedScene" uid="uid://dvkksl3mrnoto" path="res://addons/modular-settings-menu/scenes/settings-elements/discard_changes_popup.tscn" id="4_yfemx"]
+[ext_resource type="PackedScene" uid="uid://y5oxvao3aqtb" path="res://addons/modular-settings-menu/scenes/settings-sections/audio.tscn" id="5_ayxwc"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_kwbsm"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_ntlmy"]
+
+[sub_resource type="StyleBoxEmpty" id="StyleBoxEmpty_qp71p"]
+
+[node name="Settings" type="Control" unique_id=1487060885]
+layout_mode = 3
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+mouse_filter = 1
+script = ExtResource("1_crapp")
+
+[node name="SettingsPanel" type="VBoxContainer" parent="." unique_id=481915833]
+layout_mode = 1
+anchors_preset = 8
+anchor_left = 0.5
+anchor_top = 0.5
+anchor_right = 0.5
+anchor_bottom = 0.5
+offset_left = -320.0
+offset_top = -270.0
+offset_right = 320.0
+offset_bottom = 270.0
+grow_horizontal = 2
+grow_vertical = 2
+
+[node name="SettingsTabs" type="TabContainer" parent="SettingsPanel" unique_id=1124467818]
+layout_mode = 2
+size_flags_vertical = 3
+theme_override_styles/tab_focus = SubResource("StyleBoxEmpty_kwbsm")
+current_tab = 0
+
+[node name="Gameplay" parent="SettingsPanel/SettingsTabs" unique_id=354139496 instance=ExtResource("2_kjxrg")]
+layout_mode = 2
+metadata/_tab_index = 0
+
+[node name="Graphics" parent="SettingsPanel/SettingsTabs" unique_id=1265630621 instance=ExtResource("3_8fcn6")]
+visible = false
+layout_mode = 2
+metadata/_tab_index = 1
+
+[node name="Controls" parent="SettingsPanel/SettingsTabs" unique_id=1352859195 instance=ExtResource("4_3a4pu")]
+visible = false
+layout_mode = 2
+metadata/_tab_index = 2
+
+[node name="Audio" parent="SettingsPanel/SettingsTabs" unique_id=1839468677 instance=ExtResource("5_ayxwc")]
+visible = false
+layout_mode = 2
+metadata/_tab_index = 3
+
+[node name="HBoxContainer" type="HBoxContainer" parent="SettingsPanel" unique_id=1987062525]
+layout_mode = 2
+
+[node name="ApplyButton" type="Button" parent="SettingsPanel/HBoxContainer" unique_id=266503706]
+unique_name_in_owner = true
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_styles/focus = SubResource("StyleBoxEmpty_ntlmy")
+disabled = true
+text = "Apply"
+
+[node name="BackButton" type="Button" parent="SettingsPanel/HBoxContainer" unique_id=1620563241]
+layout_mode = 2
+size_flags_horizontal = 3
+theme_override_styles/focus = SubResource("StyleBoxEmpty_qp71p")
+text = "Back"
+
+[node name="ElementPanels" type="Control" parent="." unique_id=703442684]
+layout_mode = 1
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+mouse_filter = 2
+
+[node name="DiscardChangesPopup" parent="." unique_id=1211622821 instance=ExtResource("4_yfemx")]
+visible = false
+layout_mode = 1
+
+[connection signal="visibility_changed" from="." to="." method="on_visibility_changed"]
+[connection signal="pressed" from="SettingsPanel/HBoxContainer/ApplyButton" to="." method="on_apply_button_pressed"]
+[connection signal="pressed" from="SettingsPanel/HBoxContainer/BackButton" to="." method="on_back_button_pressed"]

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/button_element.gd

@@ -0,0 +1,40 @@
+extends Button
+class_name ButtonElement
+
+## Reference to the element's panel scene.
+@export var ElementPanelScene: PackedScene
+
+## Reference to the node the settings element is under.
+@onready var ParentRef: Node = owner
+
+## Reference to the element's panel.
+var ElementPanelRef: Node
+
+
+func _ready():
+	# Connect necessary signals
+	connect("pressed", pressed)
+	create_element_panel()
+
+
+func pressed() -> void:
+	# Switch panels
+	ParentRef.SettingsMenuRef.SettingsPanelRef.hide()
+	ElementPanelRef.show()
+	# Populate the settings cache of the panel
+	ElementPanelRef.get_settings()
+
+
+## Called to create the element's panel.
+func create_element_panel() -> void:
+	var ElementPanelsRef: Control = ParentRef.SettingsMenuRef.ElementPanelsRef
+	ElementPanelRef = ElementPanelScene.instantiate()
+	
+	# Check if the element panel exists
+	if not ElementPanelsRef.find_child(ElementPanelRef.name):
+		# Give a reference of the element
+		ElementPanelRef.PanelOwnerRef = self
+		ElementPanelRef.hide()
+		# Add the panel to the element panels list
+		ElementPanelsRef.add_child(ElementPanelRef)
+		ElementPanelRef.set_owner(ParentRef.SettingsMenuRef)

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/button_element.gd.uid

@@ -0,0 +1 @@
+uid://d3nlqtnyyndrg

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/multi_element.gd

@@ -0,0 +1,67 @@
+extends Control
+class_name MultiElement
+## A wrapper node for multi elements.
+
+@export var MainElementRef: SettingsElement
+@export var SUB_ELEMENTS_: Array[SettingsElement]
+
+var ParentRef: SettingsSection
+
+var currentValue :
+	get:
+		return MainElementRef.currentValue
+
+
+func _enter_tree() -> void:
+	ParentRef = owner
+	ParentRef.connect("setting_changed", update_element)
+	ParentRef.connect("apply_button_pressed", apply_settings)
+	ParentRef.SettingsMenuRef.connect("changes_discarded", load_settings)
+	SettingsDataManager.connect("settings_retrieved", load_settings)
+	init_main_element()
+	init_sub_elements()
+
+
+func init_main_element() -> void:
+	var elementId: String = MainElementRef.IDENTIFIER
+	MainElementRef.IS_MULTI_ELEMENT = true
+	MainElementRef.ParentRef = ParentRef
+	ParentRef.ELEMENT_REFERENCE_TABLE_[elementId] = MainElementRef
+
+
+## Used to initialize sub elements of the multi element.
+func init_sub_elements() -> void:
+	for ElementRef in SUB_ELEMENTS_:
+		ElementRef.IS_MULTI_ELEMENT = true
+		ElementRef.IS_SUB_ELEMENT = true
+		ElementRef.ParentRef = ParentRef
+		ParentRef.ELEMENT_REFERENCE_TABLE_[ElementRef.IDENTIFIER] = ElementRef
+
+
+## Called when settings are loaded to display the appropriate elements.
+func load_settings() -> void:
+	call_deferred("_display_sub_elements")
+
+
+## Called when the main element's value changes do display the appropriate elements.
+func update_element(elementId: String) -> void:
+	if elementId == MainElementRef.IDENTIFIER:
+		call_deferred("_display_sub_elements")
+
+
+## Called to update the visibility of sub elements based on the main elements's current value.
+## This function is overwritten by the multi element wrapper.
+func _display_sub_elements() -> void:
+	return
+
+
+## Called when the apply button is pressed.
+func apply_settings() -> void:
+	if ParentRef.changedElements_.has(MainElementRef.IDENTIFIER):
+		for SubElementRef in SUB_ELEMENTS_:
+			if (
+				not SubElementRef.is_visible_in_tree()
+				or ParentRef.changedElements_.has(SubElementRef.IDENTIFIER)
+			):
+				continue
+			SubElementRef._apply_settings()

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/multi_element.gd.uid

@@ -0,0 +1 @@
+uid://c74spwofs62nw

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/option_element.gd

@@ -0,0 +1,72 @@
+extends SettingsElement
+class_name OptionElement
+## A settings element specifically for elements that have option buttons.
+
+## Default value for the element.
+## Value has to exist in OPTION_LIST_ otherwise the first option will be used.
+@export var DEFAULT_VALUE: String
+
+## Element node references
+@export var OptionsRef: OptionButton
+
+## List of options related to the settings element
+var OPTION_LIST_
+
+## Index of the currently selected item
+var selectedIndex: int
+
+
+func _ready() -> void:
+	super._ready()
+	OPTION_LIST_.make_read_only()
+	OptionsRef.connect("item_selected", option_selected)
+
+
+func init_element() -> void:
+	fill_options_button()
+
+
+func get_valid_values() -> Dictionary:
+	if not OPTION_LIST_.has(DEFAULT_VALUE):
+		push_warning("Invalid default value for element '" + IDENTIFIER + "'.")
+		if OPTION_LIST_ is Dictionary:
+			DEFAULT_VALUE = OPTION_LIST_.keys()[0]
+		else:
+			DEFAULT_VALUE = OPTION_LIST_[0]
+	
+	return {
+		"defaultValue": DEFAULT_VALUE,
+		"validOptions": OPTION_LIST_
+	}
+
+
+## Used to initialize the option button element.
+func fill_options_button() -> void:
+	var index: int = 0
+	# Get the current item count of the option button
+	var itemCount: int = OptionsRef.get_item_count()
+	
+	# Add the options from the received option list of the element
+	for option in OPTION_LIST_:
+		# Check if the option button has not been initialized yet
+		if itemCount == 0:
+			OptionsRef.add_item(option, index)
+		# Select the option that was loaded
+		if option == currentValue:
+			OptionsRef.select(index)
+			selectedIndex = index
+		
+		index += 1
+
+
+func option_selected(index: int) -> void:
+	# Check if the settings menu is open
+	if ParentRef.settingsCache_.size() > 0:
+		# Update the settings cache with the selected option
+		ParentRef.settingsCache_[IDENTIFIER] = OptionsRef.get_item_text(index)
+		# Check if the selected value is different than the saved value
+		ParentRef.settings_changed(IDENTIFIER)
+	
+		# Update the element's values
+		currentValue = OptionsRef.get_item_text(index)
+		selectedIndex = index

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/option_element.gd.uid

@@ -0,0 +1 @@
+uid://1dxqbc07as1r

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/settings_element.gd

@@ -0,0 +1,205 @@
+extends Control
+class_name SettingsElement
+## The base script for settings elements.
+
+## Identifier for the element.
+## This value is used as the key in the settings data.
+@export var IDENTIFIER: String = "Element"
+
+## Toggle based on whether the element handles a setting that requires an in game node to exist.
+@export var IS_IN_GAME_SETTING: bool
+
+## The name of the section the element is under.
+@onready var SECTION: String = ParentRef.IDENTIFIER
+
+## Reference to the section the settings element is under.
+var ParentRef: SettingsSection
+
+# Multi element flags
+## Flag to turn an element into the main element of a multi element.
+var IS_MULTI_ELEMENT: bool = false
+## Flag to turn an element into a sub element of a multi element.
+var IS_SUB_ELEMENT: bool = false
+
+## Current value of the element.
+var currentValue
+
+
+func _enter_tree() -> void:
+	if not IS_MULTI_ELEMENT:
+		ParentRef = owner
+
+
+func _ready() -> void:
+	SettingsDataManager.connect("settings_retrieved", load_settings)
+	# Check if the element is a sub element
+	if not IS_SUB_ELEMENT:
+		ParentRef.connect("apply_button_pressed", _apply_settings)
+		# Add an entry of the settings element to the section's reference table
+		ParentRef.ELEMENT_REFERENCE_TABLE_[IDENTIFIER] = self
+
+
+## Used to initialize a settings element.
+## This function is overwritten by each [b]type[/b] of element.
+func init_element() -> void:
+	return
+
+
+## Loads the saved or default value of the element.
+func load_settings() -> void:
+	# List of valid values for the element
+	var VALUES_: Dictionary = get_valid_values()
+	VALUES_.make_read_only()
+	
+	# Check if no save file exists
+	if SettingsDataManager.noSaveFile:
+		# Assign default value as current value
+		currentValue = VALUES_["defaultValue"]
+		# Add default value of element to the settings data
+		SettingsDataManager.settingsData_[SECTION][IDENTIFIER] = currentValue
+	else:
+		# Verify the existance and validity of the element in the settings data
+		if verify_settings_data(VALUES_):
+			# Get the current value from the settings data
+			currentValue = SettingsDataManager.settingsData_[SECTION][IDENTIFIER]
+		else:
+			# Assign default value as current value
+			currentValue = VALUES_["defaultValue"]
+			# Add default value of the element to the settings data
+			SettingsDataManager.settingsData_[SECTION][IDENTIFIER] = currentValue
+			SettingsDataManager.invalidSaveFile = true
+	
+	init_element()
+	
+	# Check if the current element is in an in game menu or if it is a sub element
+	if (
+		ParentRef.SettingsMenuRef.IS_IN_GAME_MENU == IS_IN_GAME_SETTING
+		or not IS_SUB_ELEMENT
+	):
+		# Apply the loaded values to the game
+		call_deferred("_apply_settings")
+
+
+## Used to get the valid values an element can have for validating settings data.
+## This function is overwritten by each [b]type[/b] of element.
+func get_valid_values() -> Dictionary:
+	return {}
+
+
+## Checks if the loaded values are valid for the element.
+## If a value is wrong, it will be fixed automatically.
+func verify_settings_data(VALUES_: Dictionary) -> bool:
+	# Check if an entry exists for the element
+	if not entry_exists():
+		return false
+	
+	# Get the value of the element
+	var RETRIEVED_VALUE = SettingsDataManager.settingsData_[SECTION][IDENTIFIER]
+	
+	# Check if the retrieved value is the correct type
+	if not is_valid_type(VALUES_, RETRIEVED_VALUE):
+		return false
+	
+	# Check if the retrieved value has the expected value
+	if not is_valid_value(VALUES_, RETRIEVED_VALUE):
+		return false
+	
+	return true
+
+
+## Used by verify_settings_data() to check if the element 
+## and the section it is under exists in the settings data.
+func entry_exists() -> bool:
+	# Check if the section exists in settings data
+	if not SettingsDataManager.settingsData_.has(SECTION):
+		push_warning("Settings section missing: ", SECTION)
+		return false
+	
+	# Check if the element exists in the settings data
+	if not SettingsDataManager.settingsData_[SECTION].has(IDENTIFIER):
+		push_warning("Settings element is missing: ", IDENTIFIER)
+		return false
+	
+	return true
+
+
+## Used by verify_settings_data() to check if the retrieved value has the correct type.
+func is_valid_type(VALUES_: Dictionary, RETRIEVED_VALUE) -> bool:
+	if typeof(RETRIEVED_VALUE) != typeof(VALUES_["defaultValue"]):
+		push_warning(
+			"Invalid value type of '"
+			+ type_string(typeof(RETRIEVED_VALUE))
+			+ "' for element '"
+			+ IDENTIFIER
+			+ "' expected value type of '"
+			+ type_string(typeof(VALUES_["defaultValue"]))
+			+ "'"
+		)
+		return false
+	
+	return true
+
+
+## Used by verify_settings_data() to check if the retrieved value has a valid value.
+func is_valid_value(VALUES_: Dictionary, RETRIEVED_VALUE) -> bool:
+	# Get the type of the valid value
+	match typeof(VALUES_["defaultValue"]):
+		# If the type is either string or bool
+		TYPE_STRING, TYPE_BOOL:
+			# Check if the retrieved value is valid
+			if not VALUES_["validOptions"].has(RETRIEVED_VALUE):
+				push_warning(
+					"Invalid value '"
+					+ str(RETRIEVED_VALUE)
+					+ "' for element '"
+					+ IDENTIFIER
+					+ "' expected values: "
+					+ str(VALUES_["validOptions"])
+				)
+				return false
+		# If the type is either int or float
+		TYPE_INT, TYPE_FLOAT:
+			# Check if the retrieved value is valid
+			if (
+				RETRIEVED_VALUE < VALUES_["minValue"]
+				or RETRIEVED_VALUE > VALUES_["maxValue"]
+			):
+				# Special check if max fps is set to 0 (unlimited)
+				if IDENTIFIER == "MaxFPS" and RETRIEVED_VALUE == 0:
+					return true
+				
+				push_warning(
+					"Invalid value "
+					+ str(RETRIEVED_VALUE)
+					+ " for element '"
+					+ IDENTIFIER
+					+ "' expected values between "
+					+ str(VALUES_["minValue"])
+					+ " and "
+					+ str(VALUES_["maxValue"])
+				)
+				return false
+	
+	return true
+
+
+## Used to apply in game settings that require a node to exist to be applied,
+## i.e., world environment related settings and or most gameplay settings.
+func apply_in_game_setting(value = null) -> bool:
+	if ParentRef.SettingsMenuRef.IS_IN_GAME_MENU:
+		SettingsDataManager.call_deferred(
+			"emit_signal",
+			"applied_in_game_setting",
+			SECTION,
+			IDENTIFIER,
+			value
+		)
+		return true
+	
+	return false
+
+
+## Called to apply the setting to the game.
+## This function is overwritten by each [b]element[/b].
+func _apply_settings() -> void:
+	return

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/settings_element.gd.uid

@@ -0,0 +1 @@
+uid://fv4elvbeqrqg

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/slider_element.gd

@@ -0,0 +1,96 @@
+extends SettingsElement
+class_name SliderElement
+## A settings element specifically for elements that have a slider.
+
+# Default values for the element
+@export var MIN_VALUE: float = 0
+@export var MAX_VALUE: float = 1
+@export var STEP_VALUE: float = 0.1
+@export var DEFAULT_VALUE: float = 1
+
+## If true, displays 0 to 100 instead of 0 to 1 in the settings,
+## but the true value remains the same.
+@export var DISPLAY_PERCENT_VALUE: bool = false
+
+## An extra suffix for the value (optional).
+@export var VALUE_SUFFIX: String = ""
+
+## Reference to the slider of the element.
+@export var SliderRef: HSlider
+## Reference to the SpinBox or Label of the element.
+@export var ValueBoxRef: Control
+
+
+## Overwrite for SettingsElement.
+func init_element() -> void:
+	init_slider(100 if DISPLAY_PERCENT_VALUE else 1)
+
+
+## Called to initialize the slider element.
+func init_slider(FACTOR: float) -> void:
+	# Apply the min/max/step/current value of the SliderRef
+	SliderRef.set_min(MIN_VALUE * FACTOR)
+	SliderRef.set_max(MAX_VALUE * FACTOR)
+	SliderRef.set_step(STEP_VALUE * FACTOR)
+	SliderRef.set_value(currentValue * FACTOR)
+	
+	# Connect the value changed signal for the SliderRef
+	if not SliderRef.is_connected("value_changed", slider_value_changed):
+		SliderRef.connect("value_changed", slider_value_changed.bind(FACTOR))
+	
+	# Check if the value box is a spin box or a label
+	if ValueBoxRef is SpinBox:
+		# Apply the min/max/step/current value of the spin box
+		ValueBoxRef.set_min(MIN_VALUE * FACTOR)
+		ValueBoxRef.set_max(MAX_VALUE * FACTOR)
+		ValueBoxRef.set_step(STEP_VALUE * FACTOR)
+		ValueBoxRef.set_value(currentValue * FACTOR)
+		
+		# Add caret blink to spin box
+		ValueBoxRef.get_line_edit().set_caret_blink_enabled(true)
+		
+		ValueBoxRef.set_suffix(VALUE_SUFFIX)
+		
+		# Connect the value changed signal of the spin box
+		if not ValueBoxRef.is_connected("value_changed", value_box_value_changed):
+			ValueBoxRef.connect("value_changed", value_box_value_changed)
+	else:
+		# Set the text as the current value
+		ValueBoxRef.set_text(str(currentValue) + VALUE_SUFFIX)
+
+
+## Gets the valid values from the element to be used for validating data.
+func get_valid_values() -> Dictionary:
+	# Check if value is out of bounds
+	if DEFAULT_VALUE > MAX_VALUE or DEFAULT_VALUE < MIN_VALUE:
+		push_warning("Invalid default value for element '" + IDENTIFIER + "'.")
+		DEFAULT_VALUE = clampf(DEFAULT_VALUE, MIN_VALUE, MAX_VALUE)
+	
+	return {
+		"defaultValue": DEFAULT_VALUE,
+		"minValue": MIN_VALUE,
+		"maxValue": MAX_VALUE,
+	}
+
+
+## Used to update values of the section cache the element is under.
+func value_changed(value: float) -> void:
+	# Check if the settings menu is open
+	if ParentRef.settingsCache_.size() > 0:
+		ParentRef.settingsCache_[IDENTIFIER] = value
+		# Check if the new value is different than the saved value
+		ParentRef.settings_changed(IDENTIFIER)
+		currentValue = value
+
+
+func slider_value_changed(value: float, FACTOR: float) -> void:
+	if ValueBoxRef is SpinBox:
+		ValueBoxRef.set_value(value)
+	else:
+		ValueBoxRef.set_text(str(value) + VALUE_SUFFIX)
+	
+	value_changed(value / FACTOR)
+
+
+func value_box_value_changed(value: float) -> void:
+	SliderRef.set_value(value)

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/slider_element.gd.uid

@@ -0,0 +1 @@
+uid://084wuqxrcn2t

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/toggle_element.gd

@@ -0,0 +1,38 @@
+extends SettingsElement
+class_name ToggleElement
+## A settings element specifically for elements that have a toggle button.
+
+## Default value for the element
+@export var DEFAULT_VALUE: bool = false
+
+## Reference to the toggle button of the element.
+@export var ToggleRef: Button
+
+
+func _ready() -> void:
+	super._ready()
+	ToggleRef.connect("toggled", toggled)
+
+
+## Overwrite for SettingsElement.
+func init_element() -> void:
+	ToggleRef.set_pressed(currentValue)
+
+
+## Gets the valid values from the element to be used for validating data.
+func get_valid_values() -> Dictionary:
+	return {
+		"defaultValue": DEFAULT_VALUE,
+		"validOptions": [true, false]
+	}
+
+
+## Used to update values of the section cache the element is under.
+func toggled(state: bool) -> void:
+	# Check if the settings menu is open
+	if ParentRef.settingsCache_.size() > 0:
+		# Update the settings cache with the new toggle state
+		ParentRef.settingsCache_[IDENTIFIER] = state
+		# Check if the new state is different than the saved state
+		ParentRef.settings_changed(IDENTIFIER)
+		currentValue = state

evolve-die-repeat/addons/modular-settings-menu/scripts/base-settings-elements/toggle_element.gd.uid

@@ -0,0 +1 @@
+uid://djvaswjdtm251

evolve-die-repeat/addons/modular-settings-menu/scripts/element_panel.gd

@@ -0,0 +1,54 @@
+extends SettingsSection
+
+# Panel node references
+@onready var BackButtonRef: Button = $VBoxContainer/HBoxContainer/BackButton
+@onready var ApplyButtonRef: Button = $VBoxContainer/HBoxContainer/ApplyButton
+
+# Reference to the element this panel belongs to
+var PanelOwnerRef: ButtonElement
+
+
+func _ready():
+	# Connect neccessary signals
+	BackButtonRef.connect("pressed", on_back_pressed)
+	ApplyButtonRef.connect("pressed", on_apply_settings)
+	
+	# Add a reference of the section to the reference table
+	SettingsDataManager.ELEMENT_PANEL_REFERENCE_TABLE_[IDENTIFIER] = self
+	
+	# Check if a save file exists
+	if SettingsDataManager.noSaveFile:
+		# Add the section to the settings data dictionary
+		SettingsDataManager.settingsData_[IDENTIFIER] = {}
+	
+	SettingsMenuRef = owner
+	# Load the settings of the elements inside of the panel
+	call_deferred("init_elements")
+
+
+# Called to load the settings of the elements inside of the panel
+func init_elements() -> void:
+	for element in ELEMENT_REFERENCE_TABLE_:
+		ELEMENT_REFERENCE_TABLE_[element].load_settings()
+
+
+func settings_changed(elementId: String) -> void:
+	ApplyButtonRef.set_disabled(check_for_changes(elementId))
+
+
+func on_back_pressed():
+	# Check if there have been any changes made
+	if ApplyButtonRef.is_disabled():
+		# Clear the cache and return normally
+		settingsCache_.clear()
+		hide()
+		SettingsMenuRef.SettingsPanelRef.show()
+	else:
+		SettingsMenuRef.display_discard_changes(self)
+
+
+func on_apply_settings():
+	super.on_apply_settings()
+	# Save the updated settings data
+	SettingsDataManager.call_deferred("save_data")
+	ApplyButtonRef.set_disabled(true)

evolve-die-repeat/addons/modular-settings-menu/scripts/element_panel.gd.uid

@@ -0,0 +1 @@
+uid://cyig515shrgnb

evolve-die-repeat/addons/modular-settings-menu/scripts/settings-elements-scripts/audio_setting.gd

@@ -0,0 +1,13 @@
+extends SliderElement
+
+## Name of the audio bus that the volume slider is assigned to.
+@export var AUDIO_BUS: String
+
+
+# Element specific script for applying its value to the game
+func _apply_settings() -> void:
+	# Get the index of the audio bus
+	var busIndex: int = AudioServer.get_bus_index(AUDIO_BUS)
+	
+	# Set the volume of the audio bus
+	AudioServer.set_bus_volume_db(busIndex, linear_to_db(currentValue))

evolve-die-repeat/addons/modular-settings-menu/scripts/settings-elements-scripts/audio_setting.gd.uid

@@ -0,0 +1 @@
+uid://b16tk8008cqdj

evolve-die-repeat/addons/modular-settings-menu/scripts/settings-handler-scripts/camera_settings_handler.gd

@@ -0,0 +1,20 @@
+extends Node
+
+@export var CameraRef: Camera3D
+
+
+func _ready():
+	# Connect neccessary signal
+	SettingsDataManager.connect("applied_in_game_setting", apply_in_game_settings)
+
+
+# Called to apply in game settings for the specific node
+func apply_in_game_settings(section: String, element: String, value) -> void:
+	match element:
+		"FOV":
+			CameraRef.set_fov(value)
+		"DepthOfField":
+			var enabled: bool = false if value == "Disabled" else true
+			# Disable/Enable DOF
+			CameraRef.attributes.set_dof_blur_far_enabled(enabled)
+			CameraRef.attributes.set_dof_blur_near_enabled(enabled)

evolve-die-repeat/addons/modular-settings-menu/scripts/settings-handler-scripts/camera_settings_handler.gd.uid

@@ -0,0 +1 @@
+uid://b52warfwk40xd

evolve-die-repeat/addons/modular-settings-menu/scripts/settings-handler-scripts/world_env_settings_handler.gd

@@ -0,0 +1,42 @@
+extends Node
+
+@export var WorldEnvRef: WorldEnvironment
+
+@onready var EnvironmentRef: Environment = WorldEnvRef.environment
+
+
+func _ready():
+	SettingsDataManager.connect("applied_in_game_setting", apply_in_game_settings)
+
+
+# Called by elements to apply in game settings
+func apply_in_game_settings(section: String, element: String, value) -> void:
+	match element:
+		"SSRQuality":
+			if SettingsDataManager.settingsData_[section][element] == "Disabled":
+				EnvironmentRef.set_ssr_enabled(false)
+				return
+			EnvironmentRef.set_ssr_enabled(true)
+			EnvironmentRef.set_ssr_max_steps(value["maxSteps"])
+			EnvironmentRef.set_ssr_fade_in(value["fadeIn"])
+			EnvironmentRef.set_ssr_fade_out(value["fadeOut"])
+		
+		"SSAOQuality":
+			EnvironmentRef.set_ssao_enabled(
+				false if value == "Disabled" else true
+			)
+		
+		"SSILQuality":
+			EnvironmentRef.set_ssil_enabled(
+				false if value == "Disabled" else true
+			)
+		
+		"SDFGIQuality":
+			EnvironmentRef.set_sdfgi_enabled(
+				false if value == "Disabled" else true
+			)
+		
+		"GlowQuality":
+			EnvironmentRef.set_glow_enabled(
+				false if value == "Disabled" else true
+			)

evolve-die-repeat/addons/modular-settings-menu/scripts/settings-handler-scripts/world_env_settings_handler.gd.uid

@@ -0,0 +1 @@
+uid://dtgajfyolcqno

evolve-die-repeat/addons/modular-settings-menu/scripts/settings_menu.gd

@@ -0,0 +1,83 @@
+extends Control
+class_name SettingsMenu
+
+## Emitted when the settings menu is made visible.
+signal settings_menu_opened
+## Emitted when the apply button is pressed.
+signal apply_button_pressed
+## Emitted when the settings menu is hidden.
+signal settings_menu_closed
+## Emitted when changes are discarded.
+signal changes_discarded
+
+## Used to check if gameplay related settings should be applied
+@export var IS_IN_GAME_MENU: bool = true
+## Reference to the parent node of the menu UI.
+## The node this references will get set visible when pressing the back button.
+@export var MenuPanelRef: Node
+## List of settings sections that should be left out of the settings menu instance.
+@export var IGNORED_SECTIONS_: Array[String]
+
+
+@onready var DiscardChangesRef: PanelContainer = $DiscardChangesPopup
+@onready var SettingsPanelRef: VBoxContainer = $SettingsPanel
+@onready var ApplyButtonRef: Button = %ApplyButton
+
+var ElementPanelsRef: Control
+var SettingsTabsRef: TabContainer
+
+
+func _enter_tree() -> void:
+	ElementPanelsRef = $ElementPanels
+	SettingsTabsRef = $SettingsPanel/SettingsTabs
+	ignore_sections()
+
+
+func _ready():
+	# Load the settings menu
+	SettingsDataManager.call_deferred("emit_signal", "settings_retrieved")
+
+
+func on_back_button_pressed() -> void:
+	# Check if there have been any changes made
+	if ApplyButtonRef.is_disabled():
+		hide()
+		MenuPanelRef.show()
+		# Clear the settings cache
+		emit_signal("settings_menu_closed")
+	else:
+		# Display the discard changes popup
+		display_discard_changes(self)
+
+
+func on_apply_button_pressed() -> void:
+	ApplyButtonRef.set_disabled(true)
+	# Apply the settings of each section
+	emit_signal("apply_button_pressed")
+	# Save the updated settings data
+	SettingsDataManager.call_deferred("save_data")
+	# Reset the changed elements count
+	SettingsDataManager.changedElementsCount = 0
+
+
+func on_visibility_changed() -> void:
+	if is_visible_in_tree():
+		emit_signal("settings_menu_opened")
+
+
+# Called to discard the changes in the settings menu
+func discard_changes() -> void:
+	emit_signal("changes_discarded")
+	for SectionRef in SettingsTabsRef.get_children():
+		SectionRef.discard_changes()
+
+
+func display_discard_changes(CallerRef: Control) -> void:
+	DiscardChangesRef.show()
+	DiscardChangesRef.CallerRef = CallerRef
+
+
+func ignore_sections() -> void:
+	for SectionRef in SettingsTabsRef.get_children():
+		if IGNORED_SECTIONS_.has(SectionRef.IDENTIFIER):
+			SectionRef.queue_free()

evolve-die-repeat/addons/modular-settings-menu/scripts/settings_menu.gd.uid

@@ -0,0 +1 @@
+uid://houdhjao14e7

evolve-die-repeat/addons/modular-settings-menu/scripts/settings_section.gd

@@ -0,0 +1,123 @@
+extends Control
+class_name SettingsSection
+## The base script for settings sections.
+
+## Emitted when the apply button is pressed.
+signal apply_button_pressed
+## Emitted when a setting has it's value changed.
+signal setting_changed(elementId: String)
+
+## Identifier for the section.
+## This value is used as the key in the settings data.
+@export var IDENTIFIER: String
+
+## Reference to the settings menu node.
+var SettingsMenuRef: SettingsMenu
+
+## Reference table of all elements under the section.
+var ELEMENT_REFERENCE_TABLE_: Dictionary
+## Cache of all the settings values for the section.
+var settingsCache_: Dictionary
+## A list of all the elements that were changed since the settings were last applied.
+var changedElements_: Array[String]
+
+
+func _enter_tree() -> void:
+	SettingsMenuRef = owner
+
+
+func _ready():
+	# Connect neccessary signals from the central root node for the settings
+	SettingsMenuRef.connect("settings_menu_opened", get_settings)
+	SettingsMenuRef.connect("apply_button_pressed", on_apply_settings)
+	SettingsMenuRef.connect("settings_menu_closed", clear_cache)
+	
+	# Add a reference of the section to the reference table
+	SettingsDataManager.SECTION_REFERENCE_TABLE_[IDENTIFIER] = self
+	
+	# Check if a save file exists
+	if SettingsDataManager.noSaveFile:
+		# Add the section to the settings data dictionary
+		SettingsDataManager.settingsData_[IDENTIFIER] = {}
+
+
+## Called when opening the settings menu to fill the settings cache.
+func get_settings() -> void:
+	# Copy the settings data for the section into it's cache
+	settingsCache_ =\
+		SettingsDataManager.settingsData_[IDENTIFIER].duplicate(true)
+	
+	# If no save file exists saves the default values retrieved from the section's elements
+	if SettingsDataManager.noSaveFile or SettingsDataManager.invalidSaveFile:
+		SettingsDataManager.call_deferred("save_data")
+	
+	# Clear the changed elements array
+	changedElements_.clear()
+
+
+## Called to clear the section's cache.
+func clear_cache() -> void:
+	settingsCache_.clear()
+
+
+## Called when a setting has been changed.
+func settings_changed(elementId: String) -> void:
+	SettingsMenuRef.ApplyButtonRef.set_disabled(check_for_changes(elementId))
+	emit_signal("setting_changed", elementId)
+
+
+## Called to check for changes between the cache and the settings data.
+func check_for_changes(elementId: String) -> bool:
+	var cacheValue = settingsCache_[elementId]
+	var savedValue = SettingsDataManager.settingsData_[IDENTIFIER][elementId]
+	# Check if there are differences between the cache and the settings data
+	if cacheValue == savedValue:
+		# Check if the element is on the changed elements list
+		if changedElements_.has(elementId):
+			# Remove the element from the list
+			changedElements_.erase(elementId)
+			# Decrease the changed elements count
+			SettingsDataManager.changedElementsCount -= 1
+			
+		# Check if there are any other changed elements
+		if SettingsDataManager.changedElementsCount == 0:
+			# Disabled the apply button
+			return true
+	
+	# Check if the element is not the changed elements list
+	if not changedElements_.has(elementId):
+		# Add the element to the list
+		changedElements_.append(elementId)
+		# Increase the changed elements count
+		SettingsDataManager.changedElementsCount += 1
+	
+	# Enable the apply button
+	return false
+
+
+## Called to saved the data in the section's cache to the settings data
+## and apply the settings to the game.
+func on_apply_settings() -> void:
+	# Check if any of the sections elements have been changed
+	if changedElements_.size() > 0:
+		# Copy the section cache into the settings data dictionary
+		SettingsDataManager.settingsData_[IDENTIFIER] = settingsCache_.duplicate(true)
+		
+		# Apply the settings for the changed elements
+		for element in changedElements_:
+			ELEMENT_REFERENCE_TABLE_[element]._apply_settings()
+		
+		# Clear the changed elements array
+		changedElements_.clear()
+
+
+## Called to discard changes that have been made since the last save.
+func discard_changes() -> void:
+	# Check if any of the sections elements have been changed
+	if changedElements_.size() > 0:
+		# Load the saved settings for each element in the section
+		for element in changedElements_:
+			ELEMENT_REFERENCE_TABLE_[element].load_settings()
+		
+		# Clear the changed elements array
+		changedElements_.clear()

evolve-die-repeat/addons/modular-settings-menu/scripts/settings_section.gd.uid

@@ -0,0 +1 @@
+uid://c3ssroxjs8wt

evolve-die-repeat/addons/modular-settings-menu/singletons/settings_data_manager.gd

@@ -0,0 +1,212 @@
+extends Node
+## Handles the loading and saving of settings data.
+
+## Emitted when loading the settings data.
+signal settings_retrieved
+## Emitted when applying specific settings to in game objects.
+signal applied_in_game_setting(section: String, setting: String, value)
+
+## PATH to the settings save file.
+var DATA_FOLDER: String = OS.get_user_data_dir()
+## Name of the file that the settings data is saved in.
+const FILE_NAME: String = "settings"
+## Extension for the save file.
+const FILE_EXTENSION: String = ".cfg"
+## The PATH to the save file on the computer.
+var PATH: String = DATA_FOLDER + "/" + FILE_NAME + FILE_EXTENSION
+
+## Dictionary that stores all settings data.
+var settingsData_: Dictionary
+## A reference table of all sections.
+var SECTION_REFERENCE_TABLE_: Dictionary
+## A reference table of all element panels.
+var ELEMENT_PANEL_REFERENCE_TABLE_: Dictionary
+
+## The number of elements that have been changed since the settings have been saved.
+var changedElementsCount: int = 0
+
+## Flag for checking if a save file exists.
+var noSaveFile: bool
+## Flag for checking if an invalid value was found in the save file.
+var invalidSaveFile: bool = false
+
+
+func _ready() -> void:
+	# Verify the directory
+	DirAccess.make_dir_absolute(DATA_FOLDER)
+	
+	# Check if a save file exists
+	if FileAccess.file_exists(PATH):
+		# Proceed normally by retrieving data from the save file
+		call_deferred("get_data")
+	else:
+		# Enable the no save file flag
+		noSaveFile = true
+		push_warning("No save file found")
+
+
+## Called to save the settings data to the save file.
+func save_data() -> void:
+	# Create a new config instance
+	var config := ConfigFile.new()
+	
+	# Add the data from the settings data dictionary
+	for section in settingsData_:
+		for element in settingsData_[section]:
+			config.set_value(section, element, settingsData_[section][element])
+	
+	# Save the data to the specified directory
+	var err = config.save(PATH)
+	
+	# Check for errors
+	if err != OK:
+		push_error("Failed to save data_: ", err)
+		return
+	
+	# Disable the no save file flag if it was enabled
+	if noSaveFile:
+		noSaveFile = false
+	
+	# Disable the invalid save file flag if it was enabled
+	if invalidSaveFile:
+		invalidSaveFile = false
+
+
+## Called to retrieve data from the save file.
+func get_data() -> void:
+	# Create a new config instance
+	var config := ConfigFile.new()
+	# Load the save data
+	var err := config.load(PATH)
+	# Temporary data dictionary
+	var data_: Dictionary = {}
+	
+	# Check for errors
+	if err != OK:
+		push_error("Failed to load settings data_: ", err)
+		return
+	
+	# Add the retrieved data to the settings data dictionary
+	for section in config.get_sections():
+		data_[section] = {}
+		for key in config.get_section_keys(section):
+			data_[section][key] = config.get_value(section, key)
+	
+	# Verify the validity of the loaded data
+	verify_settings_data_(data_)
+	
+	# Copy the retrieved data into the settings data dictionary
+	settingsData_ = data_.duplicate(true)
+
+
+## Checks if the save file has any invalid entries and removes them or adds missing sections.
+func verify_settings_data_(data_: Dictionary) -> void:
+	# List of valid entries to compare to
+	var validEntries_: Dictionary = SECTION_REFERENCE_TABLE_.duplicate()
+	# Merge the element panel references into the valid entries
+	validEntries_.merge(ELEMENT_PANEL_REFERENCE_TABLE_)
+	# List of invalid entries to be removed
+	var invalidEntries_: Dictionary = {}
+	
+	# Itterate through the loaded settings data
+	for section in data_:
+		if is_valid_section(invalidEntries_, section):
+			verify_elements(data_, invalidEntries_, section)
+	
+	# Check if there are any sections missing from the retrieved data
+	check_for_missing_sections(data_, validEntries_)
+	
+	# Check if there are any invalid entries
+	if invalidEntries_.size() > 0:
+		# Set the invalid save file flag to true
+		invalidSaveFile = true
+		remove_invalid_entries(data_, invalidEntries_, validEntries_)
+
+
+## Used by the verify_settings_data() function to verify the retrieved sections.
+func is_valid_section(invalidEntries_: Dictionary, SECTION: String) -> bool:
+	# Check if the section is in either of the reference tables
+	if (
+		SECTION_REFERENCE_TABLE_.has(SECTION)
+		or ELEMENT_PANEL_REFERENCE_TABLE_.has(SECTION)
+	):
+		return true
+		
+	# Add the invalid section to the invalid entries list
+	invalidEntries_[SECTION] = []
+	push_warning("Invalid section '", SECTION, "' found.")
+	return false
+
+
+## Used by the verify_settings_data() function to verify the elements inside of the retrieved sections.
+func verify_elements(
+	data_: Dictionary,
+	invalidEntries_: Dictionary,
+	SECTION: String
+) -> void:
+	# Array of all elements under the section
+	var VALID_SECTION_ELEMENTS: Array = get_valid_elements(SECTION)
+	
+	# Itterate through all the elements in the section
+	for element in data_[SECTION]:
+		# Check for invalid elements
+		if not VALID_SECTION_ELEMENTS.has(element):
+			# Check if the element is in a valid section
+			if not invalidEntries_.has(SECTION):
+				# Add the section to the invalid entries list
+				invalidEntries_[SECTION] = []
+			
+			# Add the invalid element to the invalid entries list
+			invalidEntries_[SECTION].append(element)
+			push_warning(
+				"Invalid element '"
+				+ element
+				+ "' found in section '"
+				+ SECTION
+				+ "'."
+			)
+
+
+## Used by the verify_elements() function to retrieve the valid elements for the retrieved section.
+func get_valid_elements(SECTION: String) -> Array:
+	# Check if the section is a settings section
+	if SECTION_REFERENCE_TABLE_.has(SECTION):
+		return SECTION_REFERENCE_TABLE_[SECTION].ELEMENT_REFERENCE_TABLE_.keys()
+	
+	# Check if the section is an element panel
+	if ELEMENT_PANEL_REFERENCE_TABLE_.has(SECTION):
+		return ELEMENT_PANEL_REFERENCE_TABLE_[SECTION].ELEMENT_REFERENCE_TABLE_.keys()
+	
+	return []
+
+
+## Used by the verify_settings_data() function to check if any expected sections are missing.
+func check_for_missing_sections(data_: Dictionary, validEntries_: Dictionary) -> void: 
+	# Itterate through all valid sections
+	for section in validEntries_:
+		# Check if the section is missing from the loaded data_
+		if not data_.has(section):
+			# Add an empty entry for the section
+			data_[section] = {}
+			# Set the invalid save file flag to true
+			invalidSaveFile = true
+			push_warning("Settings section is missing: ", section)
+
+
+## Used by the verify_settings_data() function to remove invalid entires from the retrieved data.
+func remove_invalid_entries(
+	data_: Dictionary,
+	invalidEntries_: Dictionary,
+	validEntries_: Dictionary
+) -> void:
+	# Itterate through the sections in the invalid entries list
+	for section in invalidEntries_:
+		# Check if the section is valid
+		if validEntries_.has(section):
+			# Itterate through the invalid elements
+			for element in invalidEntries_[section]:
+				# Remove the invalid element
+				data_[section].erase(element)
+		else:
+			# Remove the invalid section
+			data_.erase(section)

evolve-die-repeat/addons/modular-settings-menu/singletons/settings_data_manager.gd.uid

@@ -0,0 +1 @@
+uid://c70d4w5cws2at

evolve-die-repeat/game_manager.gd

@@ -1,24 +1,23 @@
 extends Node
 
+# Main scene
+var mainSceneInstance
+
+# Screen
 var screen_size = Vector2(1920.0, 1080.0)  # Default screen size (this is a float for some reason)
 var viewport_size
-@onready var extent: Rect2 = get_viewport().get_visible_rect()
-
-# Main menu & game spawning
-@onready
-var mainMenuScene = preload("res://main_menu.tscn").instantiate()
-@onready
-var gameScene = preload("res://molecular/molecular_stage.tscn").instantiate()
+var extent: Rect2
 
 # utils.
 var rng = RandomNumberGenerator.new()
 var eps: float = 1e-4
+var legacy_movement: bool = false
 
 # managers
-@onready
-var foodManager = gameScene.get_node("FoodManager")
+var foodManager: FoodManager2D
 
 # A world "current"
+# TODO: This should be moved to a different "game manager" specific to the molecular stage
 # polar
 var flow_dir: float  # [0, 2pi)
 var flow_mag: float  # [0, 1]
@@ -33,24 +32,26 @@ var t: float = 0.0
 
 
 func _ready() -> void:
+	# Start game
+	mainSceneInstance = get_tree().root.get_child(-1)
+
 	# Create viewport
 	viewport_size = get_viewport().get_visible_rect().size
-	
-	# Create game (main menu)
-	add_child(mainMenuScene)
-	
+
 	# initial world current
 	get_new_flow()
 
+
 func _physics_process(delta: float) -> void:
 	t += delta
 	
 	# Flow current change
 	if abs(fmod(t, flowT)) < eps:
 		get_new_flow()
-	
-func start_game() -> void:
-	add_child(gameScene)
+
+func switch_scene(name:String) -> void:
+	if name == "respawn":
+		mainSceneInstance.go_to_respawn_scene()
 
 # TODO: This needs to be called from a script inheriting a CharacterBody2D (e.g. the player)
 # Alternative would be to pass the player reference to this script (which might be better?)
@@ -58,29 +59,29 @@ func init_screen_size(x:float, y:float) -> void:
 	screen_size.x = x
 	screen_size.y = y
 
+	extent = Rect2(Vector2(-viewport_size.x/2, -viewport_size.y/2), viewport_size + screen_size)
+
 # This can take a vector of any size (but should be 2d, other components are unused)
 func get_boundaried_position(position):
 	# clamp
 	#return position.clamp(Vector2.ZERO, screen_size)
 	
 	# periodic
-	position.x = wrapf(position.x, 0, screen_size.x)
-	position.y = wrapf(position.y, 0, screen_size.y)
+	position.x = wrapf(position.x, -viewport_size.x/2 , screen_size.x + viewport_size.x/2)
+	position.y = wrapf(position.y, -viewport_size.y/2, screen_size.y + viewport_size.y/2)
 	return position
-	
+
 func get_new_flow():
 	flow_dir = rng.randf()*2*PI
 	flow_mag = rng.randf()
 	
 	flow_x = flow_mag * cos(flow_dir)
 	flow_y = flow_mag * sin(flow_dir)
-	
-	
+
 
 func calc_distance(one, two) -> float:
 	var candidate = one.distance_to(two)
 	var onedup = one
-	# FIXME: doesnt work-- predators lose track across game boundary
 	if one.x < screen_size.x/2:
 		if one.y < screen_size.y/2:
 			# top left
@@ -105,10 +106,16 @@ func calc_distance(one, two) -> float:
 			onedup.x += screen_size.x
 			candidate = min(candidate, onedup.distance_to(two))	
 		else:
-			# botom right
+			# bottom right
 			onedup.y += screen_size.y
 			candidate = min(candidate, onedup.distance_to(two))	
 			onedup.y -= screen_size.y
 			onedup.x += screen_size.x
 			candidate = min(candidate, onedup.distance_to(two))	
 	return candidate
+
+func change_window_size(width: int, height: int) -> void:
+	# Do NOT remove this Godot, ffs!!!
+	var newSize = Vector2i(width, height)
+	
+	

evolve-die-repeat/main.tscn

@@ -0,0 +1,3 @@
+[gd_scene format=3 uid="uid://bsrxph8oa7uuj"]
+
+[node name="Main" type="Node" unique_id=1994328839]

evolve-die-repeat/main_menu.gd

@@ -1,7 +0,0 @@
-extends Control
-
-
-func _on_play_button_pressed() -> void:
-	print("Starting game by pressing button...")
-	GameManager.start_game()
-	self.queue_free()

evolve-die-repeat/main_menu.gd.uid

@@ -1 +0,0 @@
-uid://dxc66bci2ivrj

evolve-die-repeat/main_menu.tscn

@@ -1,6 +1,16 @@
 [gd_scene format=3 uid="uid://drgv154ei1vrl"]
 
-[ext_resource type="Script" uid="uid://dxc66bci2ivrj" path="res://main_menu.gd" id="1_06t4h"]
+[ext_resource type="PackedScene" uid="uid://px6a2dg8cawb" path="res://addons/modular-settings-menu/scenes/settings.tscn" id="1_06t4h"]
+
+[sub_resource type="GDScript" id="GDScript_rhts7"]
+script/source = "extends Control
+
+
+func _on_play_button_pressed() -> void:
+	print(\"Starting game by pressing button...\")
+	GameManager.start_game()
+	self.queue_free()
+"
 
 [sub_resource type="LabelSettings" id="LabelSettings_rhts7"]
 font_size = 64
@@ -12,25 +22,44 @@ anchor_right = 1.0
 anchor_bottom = 1.0
 grow_horizontal = 2
 grow_vertical = 2
-script = ExtResource("1_06t4h")
+script = SubResource("GDScript_rhts7")
 
 [node name="PlayButton" type="Button" parent="." unique_id=1831335357]
-layout_mode = 0
-offset_left = 448.0
-offset_top = 256.0
-offset_right = 768.0
-offset_bottom = 314.0
+layout_mode = 1
+anchors_preset = 8
+anchor_left = 0.5
+anchor_top = 0.5
+anchor_right = 0.5
+anchor_bottom = 0.5
+offset_left = -160.0
+offset_top = -29.0
+offset_right = 160.0
+offset_bottom = 29.0
+grow_horizontal = 2
+grow_vertical = 2
 text = "Play"
 
 [node name="MainMenuText" type="Label" parent="." unique_id=1324657553]
-layout_mode = 0
-offset_left = 320.0
-offset_top = 32.0
-offset_right = 904.0
-offset_bottom = 151.0
+layout_mode = 1
+anchors_preset = 5
+anchor_left = 0.5
+anchor_right = 0.5
+offset_left = -292.0
+offset_right = 292.0
+offset_bottom = 119.0
+grow_horizontal = 2
 text = "The Main Menu"
 label_settings = SubResource("LabelSettings_rhts7")
 horizontal_alignment = 1
 vertical_alignment = 1
 
-[connection signal="pressed" from="PlayButton" to="." method="_on_play_button_pressed"]
+[node name="Settings" parent="." unique_id=112964493 node_paths=PackedStringArray("MenuPanelRef") instance=ExtResource("1_06t4h")]
+layout_mode = 1
+MenuPanelRef = NodePath("../SettingsWheelButton")
+
+[node name="SettingsWheelButton" type="Button" parent="." unique_id=2147291321]
+layout_mode = 0
+offset_left = 898.0
+offset_top = 46.0
+offset_right = 954.0
+offset_bottom = 93.0

evolve-die-repeat/main_scene.gd

@@ -0,0 +1,61 @@
+extends Node
+
+# Main menu & game spawning
+@onready
+var mainMenuScene = preload("res://main_menu.tscn")
+var mainMenuSceneInstance: Node
+@onready
+var gameScene = preload("res://molecular/molecular_stage.tscn")
+var gameSceneInstance: Node
+@onready
+var respawnScene = preload("res://respawn_menu.tscn")
+var respawnSceneInstance: Node
+# Currently active scene (instance)
+var currentSceneInstance:Node
+
+# UI effects
+var fadeEffect: CanvasLayer
+
+
+func _ready() -> void:
+	# Instantiate effects
+	fadeEffect = $UI/Fade
+	fadeEffect.visible = false
+	
+	# Create game (main menu)
+	print("Creating Main menu...")
+	mainMenuSceneInstance = mainMenuScene.instantiate()
+	currentSceneInstance = mainMenuSceneInstance
+	add_child(currentSceneInstance)
+	
+	# Link MainMenu button to start_game
+	print("Linking Play button...")
+	mainMenuSceneInstance.get_node("PlayButton").connect("pressed", start_game)
+
+
+func start_game() -> void:
+	print("Starting game...")
+	
+	# Instatiate
+	currentSceneInstance.queue_free()
+	gameSceneInstance = gameScene.instantiate()
+	currentSceneInstance = gameSceneInstance
+	add_child(currentSceneInstance)
+	
+	# Populate GameManager with game scene
+	GameManager.foodManager = gameSceneInstance.get_node("FoodManager")
+	
+	
+func go_to_respawn_scene() -> void:
+	fadeEffect.visible = true
+	await fadeEffect.fade(1.0, 1.5).finished
+	print("Switching to Respawn scene.")
+	currentSceneInstance.queue_free()
+	
+	respawnSceneInstance = respawnScene.instantiate()
+	respawnSceneInstance.get_node("RespawnButton").connect("pressed", start_game)
+	currentSceneInstance = respawnSceneInstance
+	
+	add_child(currentSceneInstance)
+	await fadeEffect.fade(0.0, 1.5).finished
+	fadeEffect.visible = false

evolve-die-repeat/main_scene.gd.uid

@@ -0,0 +1 @@
+uid://wiv0plsu04s

evolve-die-repeat/main_scene.tscn

@@ -1,6 +1,11 @@
 [gd_scene format=3 uid="uid://b8gt8os2m28lv"]
 
-[ext_resource type="Script" uid="uid://vsbibc5fanou" path="res://game_manager.gd" id="1_0f027"]
+[ext_resource type="Script" uid="uid://wiv0plsu04s" path="res://main_scene.gd" id="1_2c62f"]
+[ext_resource type="PackedScene" uid="uid://3eg3a8ceom4l" path="res://molecular/fade.tscn" id="2_2c62f"]
 
 [node name="MainScene" type="Node" unique_id=1897047571]
-script = ExtResource("1_0f027")
+script = ExtResource("1_2c62f")
+
+[node name="UI" type="Node2D" parent="." unique_id=1032224503]
+
+[node name="Fade" parent="UI" unique_id=853660457 instance=ExtResource("2_2c62f")]

evolve-die-repeat/molecular/assets/player-sprite-attacking.png.import

@@ -0,0 +1,40 @@
+[remap]
+
+importer="texture"
+type="CompressedTexture2D"
+uid="uid://du1lb4nr47kvl"
+path="res://.godot/imported/player-sprite-attacking.png-6189c8275a257517c87cdb65abf5639a.ctex"
+metadata={
+"vram_texture": false
+}
+
+[deps]
+
+source_file="res://molecular/assets/player-sprite-attacking.png"
+dest_files=["res://.godot/imported/player-sprite-attacking.png-6189c8275a257517c87cdb65abf5639a.ctex"]
+
+[params]
+
+compress/mode=0
+compress/high_quality=false
+compress/lossy_quality=0.7
+compress/uastc_level=0
+compress/rdo_quality_loss=0.0
+compress/hdr_compression=1
+compress/normal_map=0
+compress/channel_pack=0
+mipmaps/generate=false
+mipmaps/limit=-1
+roughness/mode=0
+roughness/src_normal=""
+process/channel_remap/red=0
+process/channel_remap/green=1
+process/channel_remap/blue=2
+process/channel_remap/alpha=3
+process/fix_alpha_border=true
+process/premult_alpha=false
+process/normal_map_invert_y=false
+process/hdr_as_srgb=false
+process/hdr_clamp_exposure=false
+process/size_limit=0
+detect_3d/compress_to=1

evolve-die-repeat/molecular/assets/player-sprite-attacking2.png.import

@@ -0,0 +1,40 @@
+[remap]
+
+importer="texture"
+type="CompressedTexture2D"
+uid="uid://bsd1qtw50esai"
+path="res://.godot/imported/player-sprite-attacking2.png-3e4e9a47129b5ac21e61c82e331ba03f.ctex"
+metadata={
+"vram_texture": false
+}
+
+[deps]
+
+source_file="res://molecular/assets/player-sprite-attacking2.png"
+dest_files=["res://.godot/imported/player-sprite-attacking2.png-3e4e9a47129b5ac21e61c82e331ba03f.ctex"]
+
+[params]
+
+compress/mode=0
+compress/high_quality=false
+compress/lossy_quality=0.7
+compress/uastc_level=0
+compress/rdo_quality_loss=0.0
+compress/hdr_compression=1
+compress/normal_map=0
+compress/channel_pack=0
+mipmaps/generate=false
+mipmaps/limit=-1
+roughness/mode=0
+roughness/src_normal=""
+process/channel_remap/red=0
+process/channel_remap/green=1
+process/channel_remap/blue=2
+process/channel_remap/alpha=3
+process/fix_alpha_border=true
+process/premult_alpha=false
+process/normal_map_invert_y=false
+process/hdr_as_srgb=false
+process/hdr_clamp_exposure=false
+process/size_limit=0
+detect_3d/compress_to=1

evolve-die-repeat/molecular/assets/player-sprite.png.import

@@ -0,0 +1,40 @@
+[remap]
+
+importer="texture"
+type="CompressedTexture2D"
+uid="uid://cd0iv6hsi3fad"
+path="res://.godot/imported/player-sprite.png-f2c28aefaf4a8e7293c46f17a4267bc1.ctex"
+metadata={
+"vram_texture": false
+}
+
+[deps]
+
+source_file="res://molecular/assets/player-sprite.png"
+dest_files=["res://.godot/imported/player-sprite.png-f2c28aefaf4a8e7293c46f17a4267bc1.ctex"]
+
+[params]
+
+compress/mode=0
+compress/high_quality=false
+compress/lossy_quality=0.7
+compress/uastc_level=0
+compress/rdo_quality_loss=0.0
+compress/hdr_compression=1
+compress/normal_map=0
+compress/channel_pack=0
+mipmaps/generate=false
+mipmaps/limit=-1
+roughness/mode=0
+roughness/src_normal=""
+process/channel_remap/red=0
+process/channel_remap/green=1
+process/channel_remap/blue=2
+process/channel_remap/alpha=3
+process/fix_alpha_border=true
+process/premult_alpha=false
+process/normal_map_invert_y=false
+process/hdr_as_srgb=false
+process/hdr_clamp_exposure=false
+process/size_limit=0
+detect_3d/compress_to=1

evolve-die-repeat/molecular/fade.gd

@@ -0,0 +1,11 @@
+extends CanvasLayer
+
+@onready var color_rect: ColorRect = $ColorRect
+
+func _ready() -> void:
+	color_rect.color.a = 0
+	
+func fade(target_alpha: float, duration: float):
+	var tween = create_tween()
+	tween.tween_property(color_rect, "color:a", target_alpha, duration)
+	return tween

evolve-die-repeat/molecular/fade.gd.uid

@@ -0,0 +1 @@
+uid://bwf56ehqo32gr

evolve-die-repeat/molecular/fade.tscn

@@ -0,0 +1,14 @@
+[gd_scene format=3 uid="uid://3eg3a8ceom4l"]
+
+[ext_resource type="Script" uid="uid://bwf56ehqo32gr" path="res://molecular/fade.gd" id="1_rx8rx"]
+
+[node name="Fade" type="CanvasLayer" unique_id=853660457]
+script = ExtResource("1_rx8rx")
+
+[node name="ColorRect" type="ColorRect" parent="." unique_id=1320853444]
+anchors_preset = 15
+anchor_right = 1.0
+anchor_bottom = 1.0
+grow_horizontal = 2
+grow_vertical = 2
+color = Color(0, 0, 0, 0)

evolve-die-repeat/molecular/food/abstract_food.gd

@@ -1,21 +1,15 @@
 @abstract
 class_name AbstractFood
-extends Area2D
+extends Node
 
 @export var val: int = 1
 @export var food_name: String = "Food"
 
+
 @export var flow_carry_speed: float = 10.0
 
 signal consumed
 
-func _ready() -> void:
-	pass
-
-func _physics_process(delta: float) -> void:
-	var dpos = Vector2(GameManager.flow_x, GameManager.flow_y) * delta * flow_carry_speed
-	position += dpos
-
 func _on_body_entered(body: Node2D) -> void:
 	pass
 

evolve-die-repeat/molecular/food/food_manager.gd

@@ -1,7 +1,7 @@
 extends Node
 class_name FoodManager2D
 
-var minCount: int = 20
+var minCount: int = 0
 var _currentCount: int = 0
 
 var rng = RandomNumberGenerator.new()
@@ -19,10 +19,6 @@ func _ready() -> void:
 	spawnRange = GameManager.extent
 	call_deferred("_spawn_minimum")
 
-# Called every frame. 'delta' is the elapsed time since the previous frame.
-func _process(delta: float) -> void:
-	pass
-
 func _spawn_minimum() -> void:
 	while _currentCount < minCount:
 		_spawn_random()
@@ -38,7 +34,7 @@ func _spawn_random() -> void:
 func _spawn_food(position: Vector2) -> void:
 	var instance = foodTypes[rng.rand_weighted(foodProbs)].instantiate()
 	instance.position = position
-	add_child(instance)
+	call_deferred("add_child", instance)
 	if instance.has_signal("consumed"):
 		instance.consumed.connect(_on_entity_consumed)
 		

evolve-die-repeat/molecular/food/food_mol.gd

@@ -1,8 +1,20 @@
 extends AbstractFood
 class_name FoodMolecular
 
+@onready var collision: Area2D = $Collision
+@onready var sprite: AnimatedSprite2D = $Collision/Sprite
+@onready var player = get_tree().get_first_node_in_group("player") # FIXME: this is not v efficient; global resource? or at least per Stage.
+
 func _ready() -> void:
-	$AnimatedSprite2D.play()
+	sprite.play()
+
+
+func _physics_process(delta: float) -> void:
+	var dpos = Vector2(GameManager.flow_x, GameManager.flow_y) * delta * flow_carry_speed
+	collision.position = GameManager.get_boundaried_position(collision.position + dpos)
+
+func _process(delta):
+	collision.position = GameManager.get_boundaried_position(collision.position)
 
 func _on_body_entered(body: Node2D) -> void:
 	eat(body)
@@ -19,3 +31,10 @@ func apply_effect(consumer: Node2D) -> void:
 	if consumer.has_method("collect_resource"):  # TODO: Define a "consumer" group instead?
 		consumer.collect_resource(val)  # val is from parent (default 1), override if required
 		# TODO: *Some cool effect here*
+
+
+# FIXME: position tracking inaccurate?
+func _on_collision_input_event(viewport: Node, event: InputEvent, shape_idx: int) -> void:
+	if event is InputEventMouseButton and event.button_index == MOUSE_BUTTON_LEFT and event.pressed:
+		if player:
+			player.target = self.collision

evolve-die-repeat/molecular/food/food_mol.tscn

@@ -7,9 +7,6 @@
 [ext_resource type="Texture2D" uid="uid://dj4lyyloj1ke1" path="res://molecular/assets/food/food-left-bottom-bolt.png" id="5_i3g2v"]
 [ext_resource type="Texture2D" uid="uid://cbynycukppmup" path="res://molecular/assets/food/food-right-bottom-bolt.png" id="6_07uaq"]
 
-[sub_resource type="CircleShape2D" id="CircleShape2D_0vfbj"]
-radius = 2.0
-
 [sub_resource type="SpriteFrames" id="SpriteFrames_oo5vd"]
 animations = [{
 "frames": [{
@@ -51,28 +48,31 @@ animations = [{
 "speed": 5.0
 }]
 
-[node name="FoodMol" type="Area2D" unique_id=595352294]
-collision_layer = 8
-collision_mask = 7
+[sub_resource type="CircleShape2D" id="CircleShape2D_0vfbj"]
+radius = 5.0
+
+[node name="FoodMol" type="Node2D" unique_id=742430243]
 script = ExtResource("1_0vfbj")
+metadata/_custom_type_script = "uid://cayxffay17o0u"
 
-[node name="CollisionShape2D" type="CollisionShape2D" parent="." unique_id=762721134]
-shape = SubResource("CircleShape2D_0vfbj")
+[node name="Collision" type="Area2D" parent="." unique_id=927700818]
 
-[node name="Sprite2D" type="Sprite2D" parent="." unique_id=98693723]
+[node name="Sprite" type="AnimatedSprite2D" parent="Collision" unique_id=1856148995]
+texture_filter = 1
+sprite_frames = SubResource("SpriteFrames_oo5vd")
+frame_progress = 0.9373464
+
+[node name="Sprite2D" type="Sprite2D" parent="Collision" unique_id=98693723]
 visible = false
 scale = Vector2(0.385, 0.385)
 texture = ExtResource("2_68e2u")
 
-[node name="WrappingManager" type="Node" parent="." unique_id=1406150436 node_paths=PackedStringArray("sprite", "shape")]
+[node name="CollisionShape2D" type="CollisionShape2D" parent="Collision" unique_id=762721134]
+shape = SubResource("CircleShape2D_0vfbj")
+
+[node name="WrappingManager" type="Node" parent="." unique_id=1406150436]
 script = ExtResource("3_8lhj0")
-sprite = NodePath("../AnimatedSprite2D")
-shape = NodePath("../CollisionShape2D")
 metadata/_custom_type_script = "uid://bvbc0n0pslq7p"
 
-[node name="AnimatedSprite2D" type="AnimatedSprite2D" parent="." unique_id=1856148995]
-scale = Vector2(0.385, 0.385)
-sprite_frames = SubResource("SpriteFrames_oo5vd")
-frame_progress = 0.9373464
-
-[connection signal="body_entered" from="." to="." method="_on_body_entered"]
+[connection signal="body_entered" from="Collision" to="." method="_on_body_entered"]
+[connection signal="input_event" from="Collision" to="." method="_on_collision_input_event"]

evolve-die-repeat/molecular/molecular_player.gd

@@ -17,39 +17,56 @@ var desired_rotation: float = 0
 # Resources / money
 var resources: int = 0
 
+# Health
+var maxHealth: int = 100
+var healthPoints: int = 100
+var isAlive: bool = true
+@onready var invulnerable_cooldown_timer: Timer = $InvulnerableCooldownTimer
+var hasiframes: bool = false  # only used for iframe after collision for now
+var target = Vector2.ZERO # either vector2 or Node2D
+
 func _ready() -> void:
 	var screen_size = get_viewport_rect().size
 	GameManager.init_screen_size(screen_size.x, screen_size.y)
 	
-	attack_area.monitoring = false # no collision until attacking TODO: Thing about being attacked
+	attack_area.monitoring = false # no collision until attacking TODO: Think about being attacked
 	attack_timer.wait_time = attack_duration
 	attack_cooldown_timer.wait_time = attack_cooldown_duration
+	
+	sprite.play("default")
+
+
+func _input(event):
+	# TODO: only does clicks/taps; accept mouse drags
+	if event is InputEventMouseButton and event.button_index == MOUSE_BUTTON_LEFT and event.pressed:
+		target = get_global_mouse_position()
+
+func _physics_process(delta):
+	var pos
+	if typeof(target) == TYPE_VECTOR2:
+		pos = target
+	elif "position" in target:
+		pos = target.position
+	else:
+		return
+	var dir: Vector2 = position.direction_to(pos)
+
+	if position.distance_to(pos) > 2:
+		self.desired_rotation = atan2(dir.y, dir.x)
+		move_and_collide(speed * dir * delta)
+		position = GameManager.get_boundaried_position(position)
 
 
 func _process(delta):
-	velocity = Vector2.ZERO
-	if Input.is_action_pressed("move_right"):
-		velocity.x += 1
-	if Input.is_action_pressed("move_left"):
-		velocity.x -= 1
-	if Input.is_action_pressed("move_down"):
-		velocity.y += 1
-	if Input.is_action_pressed("move_up"):
-		velocity.y -= 1
-	if Input.is_action_pressed("try_attack"):
-		try_attack()
+	if isAlive:
+		if Input.is_action_pressed("try_attack"):
+			try_attack()
 
-
-	if not velocity.is_zero_approx():
-		self.desired_rotation = atan2(velocity.y, velocity.x)
-		
 	# smoothly rotate
 	if self.rotation != self.desired_rotation: 
 		self.rotation = lerp_angle(self.rotation, self.desired_rotation, clampf(4 * delta, 0, 1))
-
-	move_and_collide(speed * velocity * delta)
-	position = GameManager.get_boundaried_position(position)
 	
+
 func try_attack() -> void:
 	if not can_attack:
 		return
@@ -66,7 +83,7 @@ func _on_attack_timeout() -> void:
 	sprite.play("default")
 	attack_cooldown_timer.start()
 	
-func _on_cooldown_timeout() -> void:
+func _on_attack_cooldown_timeout() -> void:
 	can_attack = true
 	
 func _on_attack_hit(body: Node2D) -> void:
@@ -75,17 +92,39 @@ func _on_attack_hit(body: Node2D) -> void:
 		if body.has_method("handle_damage"):
 			body.handle_damage(damage, self)
 			hit_hittable = true
-	elif body.is_in_group("resources"):
-		pass
 	if hit_hittable:
 		await get_tree().create_timer(0.2).timeout
 		sprite.play("default")
-		# TODO: resource handling logic
+		
+func _on_invulnerable_cooldown_timeout() -> void:
+	hasiframes = false
 
 func handle_damage(dmg: int, src: Node) -> void:
-	# TODO: damage logic
-	pass	
+	# TODO: enhanced damage logic (src entity effects?)
+	if not hasiframes:
+		print("Player took %d damage." % dmg)
+		healthPoints -= dmg
+		hasiframes = true
+		invulnerable_cooldown_timer.start()
+	if isAlive and healthPoints <= 0:
+		die()
 	
 func collect_resource(damnt: int) -> void:
 	resources += damnt
 	print("Resource collected! Total: ", resources)
+	
+func die() -> void:
+	print("Player died.")
+	isAlive = false
+	GameManager.switch_scene("respawn")
+
+# TODO: Is this used or should it be removed? (currently unused)
+func respawm() -> void:
+	healthPoints = maxHealth
+	isAlive = true
+	hasiframes = true
+	attack_cooldown_timer.start()
+	
+
+	
+	

evolve-die-repeat/molecular/molecular_player.tscn

@@ -1,14 +1,21 @@
 [gd_scene format=3 uid="uid://dxluckxdkpv4f"]
 
 [ext_resource type="Script" uid="uid://di7eglnrnqm6i" path="res://molecular/molecular_player.gd" id="1_0ix7k"]
-[ext_resource type="Texture2D" uid="uid://boknmstvkc0a2" path="res://molecular/assets/player-sprite-placeholder-attacking-crop.png" id="2_5hxmy"]
-[ext_resource type="Texture2D" uid="uid://cxwvga07sm3yl" path="res://molecular/assets/player-sprite-placeholder-crop.png" id="2_en8op"]
+[ext_resource type="Texture2D" uid="uid://du1lb4nr47kvl" path="res://molecular/assets/player-sprite-attacking.png" id="2_rq1v6"]
+[ext_resource type="Texture2D" uid="uid://bsd1qtw50esai" path="res://molecular/assets/player-sprite-attacking2.png" id="3_xiwfn"]
+[ext_resource type="Texture2D" uid="uid://cd0iv6hsi3fad" path="res://molecular/assets/player-sprite.png" id="4_rq1v6"]
 
 [sub_resource type="SpriteFrames" id="SpriteFrames_onrkg"]
 animations = [{
 "frames": [{
-"duration": 1.0,
-"texture": ExtResource("2_5hxmy")
+"duration": 0.5,
+"texture": ExtResource("2_rq1v6")
+}, {
+"duration": 4.0,
+"texture": ExtResource("3_xiwfn")
+}, {
+"duration": 0.5,
+"texture": ExtResource("2_rq1v6")
 }],
 "loop": true,
 "name": &"attacking",
@@ -16,19 +23,18 @@ animations = [{
 }, {
 "frames": [{
 "duration": 5.0,
-"texture": ExtResource("2_en8op")
+"texture": ExtResource("4_rq1v6")
 }],
 "loop": true,
 "name": &"default",
 "speed": 5.0
 }]
 
-[sub_resource type="CircleShape2D" id="CircleShape2D_5hxmy"]
-radius = 378.18
-
 [sub_resource type="CapsuleShape2D" id="CapsuleShape2D_4flbx"]
-radius = 191.95984
-height = 1295.8773
+radius = 5.999982
+height = 27.990019
+
+[sub_resource type="CircleShape2D" id="CircleShape2D_5hxmy"]
 
 [node name="player" type="CharacterBody2D" unique_id=2032508208]
 collision_mask = 14
@@ -36,8 +42,12 @@ script = ExtResource("1_0ix7k")
 
 [node name="AnimatedSprite2D" type="AnimatedSprite2D" parent="." unique_id=1745800698]
 visibility_layer = 2
-scale = Vector2(0.5, 0.5)
 sprite_frames = SubResource("SpriteFrames_onrkg")
+animation = &"attacking"
+
+[node name="CollisionShape2D" type="CollisionShape2D" parent="." unique_id=2137063701 groups=["player"]]
+rotation = -1.5732701
+shape = SubResource("CapsuleShape2D_4flbx")
 
 [node name="AttackArea" type="Area2D" parent="." unique_id=187975387]
 position = Vector2(0, 56)
@@ -45,20 +55,20 @@ rotation = -1.5732701
 collision_mask = 6
 
 [node name="CollisionShape2D" type="CollisionShape2D" parent="AttackArea" unique_id=1968501358]
-position = Vector2(41.029465, 288.86832)
+position = Vector2(55.977566, 9.138502)
 shape = SubResource("CircleShape2D_5hxmy")
 debug_color = Color(0.80813414, 0.3957308, 0.3356335, 0.41960785)
 
-[node name="CollisionShape2D" type="CollisionShape2D" parent="." unique_id=2137063701 groups=["player"]]
-rotation = -1.5732701
-shape = SubResource("CapsuleShape2D_4flbx")
-
 [node name="AttackTimer" type="Timer" parent="." unique_id=2057433652]
 one_shot = true
 
 [node name="AttackCooldownTimer" type="Timer" parent="." unique_id=1056439284]
 one_shot = true
 
+[node name="InvulnerableCooldownTimer" type="Timer" parent="." unique_id=311411582]
+one_shot = true
+
 [connection signal="body_entered" from="AttackArea" to="." method="_on_attack_hit"]
 [connection signal="timeout" from="AttackTimer" to="." method="_on_attack_timeout"]
-[connection signal="timeout" from="AttackCooldownTimer" to="." method="_on_cooldown_timeout"]
+[connection signal="timeout" from="AttackCooldownTimer" to="." method="_on_attack_cooldown_timeout"]
+[connection signal="timeout" from="InvulnerableCooldownTimer" to="." method="_on_invulnerable_cooldown_timeout"]

evolve-die-repeat/molecular/predator/collision.gd

@@ -0,0 +1,26 @@
+extends CharacterBody2D
+
+var desired_rotation: float = self.rotation
+@export var speed = 0.8
+
+# Called every frame. 'delta' is the elapsed time since the previous frame.
+func _process(delta: float) -> void: 
+	# smoothly rotate
+	if self.rotation != self.desired_rotation: 
+		self.rotation = lerp_angle(self.rotation, self.desired_rotation, clampf(4 * delta, 0, 1))
+
+func move(motion: Vector3, mod: float) -> void:
+	self.desired_rotation = atan2(motion.y, motion.x)	
+	move_and_collide(Vector2(motion.x, motion.y).normalized() * self.speed * mod)  # Moves along the given vector
+	
+	# Apply boundary to new position
+	position = GameManager.get_boundaried_position(position)
+	
+func handle_damage(dmg: int, src: Node) -> void:
+	if owner:
+		owner.handle_damage(dmg, src)
+
+func duplicate_init() -> void:
+	var sight = $Sight
+	remove_child(sight)
+	sight.queue_free()

evolve-die-repeat/molecular/predator/collision.gd.uid

@@ -0,0 +1 @@
+uid://cus6ogtwxx4v7

evolve-die-repeat/molecular/predator/hammerhead_predator.gd

@@ -1,40 +1,33 @@
-extends AbstractPredator2D
+extends AbstractPredator
 
 # FIXME: (general) tracking across wrapping boundary
 
+var starting_pos
 var can_attack: bool = true
-var desired_rotation: float = self.rotation
-@onready var sprite = $AnimatedSprite2D
 @onready var fsm: StateMachine = $StateMachine
 @onready var attack_cooldown_timer: Timer = $AttackCooldownTimer
 @onready var wrapper: WrappingManager = $WrappingManager
-
+@onready var collision: CharacterBody2D = $Collision
+@onready var sprite = $Collision/Sprite
 @export var damage: int = 15
-@export var attack_range = 20
+@export var attack_range = 40
 @export var sight_range = 200
-@export var speed = 0.8
 
 func _ready() -> void:
 	health = maxHealth
-	sprite.play("Healthy")
+	play_sprite(idle_sprite)
+	if starting_pos:
+		collision.set_position(starting_pos)
 	
-	
-# Called every frame. 'delta' is the elapsed time since the previous frame.
-func _process(delta: float) -> void: 
-	# smoothly rotate
-	if self.rotation != self.desired_rotation: 
-		self.rotation = lerp_angle(self.rotation, self.desired_rotation, clampf(4 * delta, 0, 1))
-
-func _physics_process(delta: float) -> void:
-	pass
-
-# FIXME: (also goes for prey) this is framerate dependent UNLESS called from a _physics function.
 func move(motion: Vector3, mod: float = 1.0) -> void:
-	move_and_collide(Vector2(motion.x, motion.y).normalized() * self.speed * mod)  # Moves along the given vector
-	self.desired_rotation = atan2(motion.y, motion.x)	
-		
-	# Apply boundary to new position
-	position = GameManager.get_boundaried_position(position)
+	collision.move(motion, mod)
+
+	
+func set_position(pos: Vector2) -> void:
+	if collision:
+		collision.set_position(pos)	
+	else: 
+		starting_pos = pos
 
 func try_attack(target: Node) -> void:
 	if not can_attack:
@@ -46,11 +39,8 @@ func attack(target: Node) -> void:
 	var hit_hittable = false
 	if target.is_in_group("prey") or target.is_in_group("player"):
 		if target.has_method("handle_damage"):
-			target.handle_damage(damage, self)
+			target.handle_damage(damage, self.collision)
 			hit_hittable = true
-	elif target.is_in_group("resources"):
-		# TODO: resource handling logic
-		pass
 	if hit_hittable:
 		attack_cooldown_timer.start()
 	
@@ -70,8 +60,8 @@ func die() -> void:
 	super.die()
 
 func become_injured() -> void:
-	sprite.play("Hurt")
-	wrapper.play_sprite("Hurt")	
+	idle_sprite = "Hurt"
+	play_sprite(idle_sprite)
 
 func _on_sight_body_entered(body: Node2D) -> void:
 	if fsm.map(fsm.state) != fsm.States.HUNTING and body.is_in_group("prey") or (health < maxHealth and body.is_in_group("player")):
@@ -79,3 +69,9 @@ func _on_sight_body_entered(body: Node2D) -> void:
 
 func _on_attack_cooldown_timer_timeout() -> void:
 	can_attack = true
+
+
+func _on_collision_input_event(viewport: Node, event: InputEvent, shape_idx: int) -> void:
+	if event is InputEventMouseButton and event.button_index == MOUSE_BUTTON_LEFT and event.pressed:
+		if player:
+			player.target = self.collision

evolve-die-repeat/molecular/predator/hammerhead_predator.tscn

@@ -1,6 +1,7 @@
 [gd_scene format=3 uid="uid://s4s66oaexava"]
 
 [ext_resource type="Script" uid="uid://d07cjelbqbiug" path="res://molecular/predator/hammerhead_predator.gd" id="1_xp037"]
+[ext_resource type="Script" uid="uid://cus6ogtwxx4v7" path="res://molecular/predator/collision.gd" id="2_7qt2q"]
 [ext_resource type="Texture2D" uid="uid://ch5rddsumyyhm" path="res://molecular/assets/predator/predator-healthy.png" id="2_34kwa"]
 [ext_resource type="Texture2D" uid="uid://30uwkdbnuu3h" path="res://molecular/assets/predator/hammerheadRibozyme-hunting.png" id="3_0ts4d"]
 [ext_resource type="Script" uid="uid://cygrmt03sx0k1" path="res://molecular/predator/state_machine.gd" id="3_xp037"]
@@ -91,32 +92,44 @@ animations = [{
 "speed": 5.0
 }]
 
-[node name="HammerheadPredator" type="CharacterBody2D" unique_id=678504815 groups=["predator"]]
-scale = Vector2(0.3, 0.3)
-collision_layer = 4
-collision_mask = 3
-motion_mode = 1
+[node name="HammerheadPredator" type="Node" unique_id=1312337720]
 script = ExtResource("1_xp037")
 maxHealth = 50
 metadata/_custom_type_script = "uid://dgfimmq53whll"
 
-[node name="WrappingManager" type="Node" parent="." unique_id=826586678 node_paths=PackedStringArray("sprite", "shape")]
-script = ExtResource("9_shhro")
-sprite = NodePath("../AnimatedSprite2D")
-shape = NodePath("../CollisionPolygon2D")
-metadata/_custom_type_script = "uid://bvbc0n0pslq7p"
+[node name="Collision" type="CharacterBody2D" parent="." unique_id=76553184 groups=["predator"]]
+scale = Vector2(0.8, 0.8)
+collision_layer = 4
+collision_mask = 3
+input_pickable = true
+script = ExtResource("2_7qt2q")
 
-[node name="CollisionPolygon2D" type="CollisionPolygon2D" parent="." unique_id=1596156928]
+[node name="Sprite" type="AnimatedSprite2D" parent="Collision" unique_id=410999609]
+rotation = -1.5707964
+sprite_frames = SubResource("SpriteFrames_shhro")
+animation = &"Healthy"
+
+[node name="CollisionPolygon2D" type="CollisionPolygon2D" parent="Collision" unique_id=1596156928]
 light_mask = 4
 visibility_layer = 4
 position = Vector2(0.111679085, 1.1167793)
 rotation = -1.5707964
 polygon = PackedVector2Array(-22.184862, -27.994831, 23.481365, -27.21198, 13.82622, 25.891317, -6.005971, 25.891317)
 
-[node name="AnimatedSprite2D" type="AnimatedSprite2D" parent="." unique_id=410999609]
-rotation = 4.712389
-sprite_frames = SubResource("SpriteFrames_shhro")
-animation = &"Hunting"
+[node name="Sight" type="Area2D" parent="Collision" unique_id=1608385873]
+collision_layer = 0
+collision_mask = 7
+
+[node name="CollisionPolygon2D" type="CollisionPolygon2D" parent="Collision/Sight" unique_id=1707240701]
+light_mask = 4
+visibility_layer = 4
+position = Vector2(-1.0900421, 1.6350927)
+rotation = -1.5707964
+polygon = PackedVector2Array(14.135091, 27.34004, 56.058624, 148.93633, 22.979004, 163.77974, -19.854843, 161.65926, -53.782654, 143.84715, -5.8649073, 27.34004)
+
+[node name="WrappingManager" type="Node" parent="." unique_id=826586678]
+script = ExtResource("9_shhro")
+metadata/_custom_type_script = "uid://bvbc0n0pslq7p"
 
 [node name="StateMachine" type="Node" parent="." unique_id=1857729810 node_paths=PackedStringArray("initial_state")]
 script = ExtResource("3_xp037")
@@ -138,22 +151,12 @@ one_shot = true
 [node name="Hunting" type="Node" parent="StateMachine" unique_id=1569866955]
 script = ExtResource("8_7qt2q")
 
-[node name="Sight" type="Area2D" parent="." unique_id=1608385873]
-collision_layer = 0
-collision_mask = 7
-
-[node name="CollisionPolygon2D" type="CollisionPolygon2D" parent="Sight" unique_id=1707240701]
-light_mask = 4
-visibility_layer = 4
-position = Vector2(-1.0900421, 1.6350927)
-rotation = -1.5707964
-polygon = PackedVector2Array(-27.769547, -29.426758, 31.88504, -29.184647, 12.700996, 28.7294, 56.058624, 148.93633, 22.979004, 163.77974, -19.854843, 161.65926, -53.782654, 143.84715, -8.333115, 30.157196)
-
 [node name="AttackCooldownTimer" type="Timer" parent="." unique_id=435253442]
 wait_time = 0.5
 one_shot = true
 
+[connection signal="input_event" from="Collision" to="." method="_on_collision_input_event"]
+[connection signal="body_entered" from="Collision/Sight" to="." method="_on_sight_body_entered"]
 [connection signal="timeout" from="StateMachine/Idle/Timer" to="StateMachine/Idle" method="_on_timer_timeout"]
 [connection signal="timeout" from="StateMachine/RandomMovement/Timer" to="StateMachine/RandomMovement" method="_on_timer_timeout"]
-[connection signal="body_entered" from="Sight" to="." method="_on_sight_body_entered"]
 [connection signal="timeout" from="AttackCooldownTimer" to="." method="_on_attack_cooldown_timer_timeout"]

evolve-die-repeat/molecular/predator/state_hunting.gd

@@ -5,22 +5,22 @@ var target: Node2D
 func enter(previous_state_path: String, data := {}) -> void:
 	if data.has("target"):
 		target = data["target"]
-		owner.sprite.play("Hunting")
+		owner.play_sprite("Hunting")
 	else:
 		# default behaviour; do nothing
 		finished.emit(owner.fsm.States.IDLE, {})
 
 func physics_update(_delta: float) -> void:
-	if target == null or GameManager.calc_distance(owner.position, target.position) > owner.sight_range:
+	if target == null or GameManager.calc_distance(owner.collision.position, target.position) > owner.sight_range:
 		finished.emit(owner.fsm.States.IDLE, {}) 
 		return
 	
 	# alternatively, we could use a collision shape and inbuilt signals, but im not sure if that works better (mixing signals and custom fsm stuff i mean
-	if GameManager.calc_distance(owner.position, target.position) > owner.attack_range:
+	if GameManager.calc_distance(owner.collision.position, target.position) > owner.attack_range:
 		owner.move(move_towards(target.position))
 	else:
 		owner.attack(target)
 
 func move_towards(pos: Vector2) -> Vector3:
-	var diff = target.position - owner.position
+	var diff = target.position - owner.collision.position
 	return Vector3(diff.x, diff.y ,0)	

evolve-die-repeat/molecular/prey/collision.gd

@@ -0,0 +1,28 @@
+extends CharacterBody2D
+
+var desired_rotation: float = self.rotation
+@export var speed = 0.5
+
+
+# Called every frame. 'delta' is the elapsed time since the previous frame.
+func _process(delta: float) -> void: 
+	# smoothly rotate
+	if self.rotation != self.desired_rotation: 
+		self.rotation = lerp_angle(self.rotation, self.desired_rotation, clampf(4 * delta, 0, 1))
+	
+func move(motion: Vector3, mod: float) -> void:
+	move_and_collide(Vector2(motion.x, motion.y).normalized() * self.speed * mod)  # Moves along the given vector
+	self.desired_rotation = atan2(motion.y, motion.x)	
+		
+	# Apply boundary to new position
+	position = GameManager.get_boundaried_position(position)
+
+
+func handle_damage(dmg: int, src: Node) -> void:
+	if owner:
+		owner.handle_damage(dmg, src)
+
+func duplicate_init() -> void:
+	var sight = $Sight
+	remove_child(sight)
+	sight.queue_free()